| Revision as of 16:25, 10 January 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,055 edits Saving copy of the {{chembox}} taken from revid 468365557 of page Yellow_2G for the Chem/Drugbox validation project (updated: 'CASNo'). |
Latest revision as of 13:44, 19 March 2024 edit Tautropfli (talk | contribs)149 editsm Use of Unbulleted list macro for OtherNames property of Chembox as is the recommendation in the docs.Tag: 2017 wikitext editor |
| Line 1: |
Line 1: |
|
|
{{Use dmy dates|date=January 2023}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
|
{{chembox |
|
{{chembox |
|
|
| Verifiedfields = changed |
|
| verifiedrevid = 439405493 |
|
| verifiedrevid = 470634627 |
|
| ImageFile = Yellow 2G sodium.png |
|
| ImageFile = Yellow 2G sodium.svg |
|
| ImageSize = 200px |
|
| ImageSize = 250px |
|
| IUPACName = Disodium 2,5-dichloro-4-benzenesulfonate |
|
| IUPACName = Disodium 2,5-dichloro-4-benzenesulfonate |
|
| OtherNames = Lissamine Fast Yellow; C.I. Acid Yellow 17; C.I. 18965; Light Fast Yellow 2G; C.I. Food Yellow 5; Acid Leather Yellow 2GL; Erio Flavine SX; Fenalan Yellow G; Erio Flavine 3G; Kayacyl Yellow GG |
|
| OtherNames = {{Unbulleted list|Lissamine Fast Yellow|C.I. Acid Yellow 17|C.I. 18965|Light Fast Yellow 2G|C.I. Food Yellow 5|Acid Leather Yellow 2GL|Erio Flavine SX|Fenalan Yellow G|Erio Flavine 3G|Kayacyl Yellow GG}} |
|
| Section1 = {{Chembox Identifiers |
|
| Section1 = {{Chembox Identifiers |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 3490830 |
|
| ChemSpiderID = 3490830 |
|
|
| index2_label=tautomer |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
|
|
| ChEBI2_Ref = {{ebicite|changed|EBI}} |
| ⚫ |
| StdInChI = 1S/C16H12Cl2N4O7S2/c1-8-15(20-19-9-2-4-10(5-3-9)30(24,25)26)16(23)22(21-8)13-6-12(18)14(7-11(13)17)31(27,28)29/h2-7,15H,1H3,(H,24,25,26)(H,27,28,29)/p-2/b20-19+ |
|
|
|
| ChEBI2 = 90206 |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
|
|
| StdInChI=1S/C16H12Cl2N4O7S2.2Na/c1-8-15(20-19-9-2-4-10(5-3-9)30(24,25)26)16(23)22(21-8)13-6-12(18)14(7-11(13)17)31(27,28)29;;/h2-7,15H,1H3,(H,24,25,26)(H,27,28,29);;/q;2*+1/p-2 |
|
| StdInChIKey = DWYWPBYWDAZKNX-FMQUCBEESA-L |
|
| StdInChIKey = FTZLWXQKVFFWLY-UHFFFAOYSA-L |
| ⚫ |
| InChI = 1S/C16H12Cl2N4O7S2/c1-8-15(20-19-9-2-4-10(5-3-9)30(24,25)26)16(23)22(21-8)13-6-12(18)14(7-11(13)17)31(27,28)29/h2-7,15H,1H3,(H,24,25,26)(H,27,28,29)/p-2/b20-19+ |
|
|
⚫ |
| InChI1 = 1S/C16H12Cl2N4O7S2/c1-8-15(20-19-9-2-4-10(5-3-9)30(24,25)26)16(23)22(21-8)13-6-12(18)14(7-11(13)17)31(27,28)29/h2-7,15H,1H3,(H,24,25,26)(H,27,28,29)/p-2/b20-19+ |
|
| InChIKey1 = DWYWPBYWDAZKNX-FMQUCBEESA-L |
|
| InChIKey1 = DWYWPBYWDAZKNX-FMQUCBEESA-L |
|
| CASNo_Ref = {{cascite|correct|??}} |
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
| CASNo = <!-- blanked - oldvalue: 6359-98-4 --> |
|
| CASNo = 6359-98-4 |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
| ⚫ |
| PubChem = 4284331 |
|
|
|
| UNII = Y428W9WW4D |
|
|
| PubChem = 22842 |
|
|
| index1_label = acid |
|
⚫ |
| PubChem1 = 4284331 |
|
| SMILES = CC1=NN(C(=O)C1N=NC2=CC=C(C=C2)S(=O)(=O))C3=CC(=C(C=C3Cl)S(=O)(=O))Cl.. |
|
| SMILES = CC1=NN(C(=O)C1N=NC2=CC=C(C=C2)S(=O)(=O))C3=CC(=C(C=C3Cl)S(=O)(=O))Cl.. |
|
}} |
|
}} |
|
| Section2 = {{Chembox Properties |
|
| Section2 = {{Chembox Properties |
|
|
| C=16 | H=10 | Na=2 | N=4 | O=7 | S=2 |
|
| Formula = C<sub>16</sub>H<sub>10</sub>Na<sub>2</sub>N<sub>4</sub>O<sub>7</sub>S<sub>2</sub> |
|
|
| MolarMass = 551.29 g/mol |
|
|
| Appearance = |
|
| Appearance = |
|
| Density = |
|
| Density = |
| Line 32: |
Line 37: |
|
| MainHazards = |
|
| MainHazards = |
|
| FlashPt = |
|
| FlashPt = |
|
| Autoignition = |
|
| AutoignitionPt = |
|
| RPhrases = |
|
|
| SPhrases = {{S24}} {{S25}} {{S28}}A {{S37}} {{S45}} |
|
|
}} |
|
}} |
|
}} |
|
}} |
|
|
|
|
|
'''Yellow 2G''' is a ] denoted by ] '''E107''' with the ] '''CI18965'''. It has the appearance of a yellow powder, and it is soluble in water. It is a synthetic yellow ]. |
|
|
|
|
|
It is not listed by the UK's ] among EU approved food additives.<ref>, ], 26 November 2010</ref> Its use is also banned in ], ], ], ], ] and the ].{{Citation needed|date=January 2011}} |
|
|
|
|
|
==References== |
|
|
{{reflist}} |
|
|
|
|
|
==External links== |
|
|
{{commonscatinline}} |
|
|
|
|
|
{{DEFAULTSORT:Yellow 2g}} |
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
] |