Revision as of 09:08, 23 October 2010 editJynto (talk | contribs)Extended confirmed users3,201 edits Adding ball-and-stick model← Previous edit |
Latest revision as of 23:53, 8 January 2025 edit undoBkell (talk | contribs)Administrators60,890 editsm proper primes |
(52 intermediate revisions by 32 users not shown) |
Line 1: |
Line 1: |
|
{{chembox |
|
{{chembox |
|
|
| Verifiedfields = changed |
⚫ |
| Name =''para''-Terphenyl |
|
|
|
| Watchedfields = changed |
⚫ |
| Reference = |
|
|
|
| verifiedrevid = 392374283 |
|
| ImageFile = Para-terphenyl.png |
|
|
⚫ |
| Name =''para''-Terphenyl |
|
| ImageSize = 200px |
|
|
⚫ |
| Reference = |
⚫ |
| ImageName = Skeletal formula of para-terphenyl |
|
|
| ImageFile1 = Para-terphenyl-3D-balls.png |
|
| ImageFile = Para-terphenyl.png |
|
| ImageSize1 = 200px |
|
| ImageSize = |
|
| ImageName1 = Ball-and-stick model of para-terphenyl |
|
| ImageName = Skeletal formula of para-terphenyl |
|
|
| ImageFile1 = Para-terphenyl-from-xtal-view-2-3D-bs-17.png |
|
| IUPACName = 1,4-Diphenylbenzene |
|
|
|
| ImageSize1 = |
⚫ |
| OtherNames=''p''-Terphenyl; 1,4-Diphenylbenzene; ''para''-Diphenylbenzene; ''p''-Diphenylbenzene; ''para''-Triphenyl; ''p''-Triphenyl |
|
|
⚫ |
| ImageName1 = Ball-and-stick model of para-terphenyl |
|
|
| PIN = 1<sup>1</sup>,2<sup>1</sup>:2<sup>4</sup>,3<sup>1</sup>-Terphenyl<ref name=iupac2013>{{cite book | title = Nomenclature of Organic Chemistry : IUPAC Recommendations and Preferred Names 2013 (Blue Book) | publisher = ] | date = 2014 | location = Cambridge | page = 345 | doi = 10.1039/9781849733069-00130 | isbn = 978-0-85404-182-4}}</ref> |
|
⚫ |
| OtherNames = 1,1′:4′,1″-Terphenyl<ref name=iupac2013/><br />''p''-Terphenyl<br />1,4-Diphenylbenzene<br />''para''-Diphenylbenzene<br />''p''-Diphenylbenzene<br />''para''-Triphenyl<br />''p''-Triphenyl |
|
|Section1={{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
| CASNo=92-94-4 |
|
| CASNo = 92-94-4 |
|
| CASOther= (''para'')<br>92-06-8 (''meta'')<br>84-15-1 (''ortho'')<br>26140-60-3 (unspec.) |
|
|
|
| CASNo_Comment = (''para'') |
|
| PubChem=7115 |
|
|
|
| CASNo2_Ref = {{cascite|correct|CAS}} |
⚫ |
| SMILES=C1=CC=C(C=C1)C2=CC=C(C=C2)C3=CC=CC=C3 |
|
|
|
| CASNo2 = 92-06-8 |
|
|
| CASNo2_Comment = (''meta'') |
|
|
| CASNo3_Ref = {{cascite|correct|CAS}} |
|
|
| CASNo3 = 84-15-1 |
|
|
| CASNo3_Comment = (''ortho'') |
|
|
| CASNo4_Ref = {{cascite|correct|CAS}} |
|
|
| CASNo4 = 26140-60-3 |
|
|
| CASNo4_Comment = (unspecified) |
|
|
| Beilstein = 1908447 |
|
|
| ChEMBL1 = 491582 |
|
|
| ChEBI1 = 52242 |
|
|
| PubChem =7115 |
|
|
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|
|
| ChemSpiderID = 6848 |
|
|
| ChemSpiderID_Comment = (''para'') |
|
|
| EC_number1 = 202-205-2 |
|
|
| RTECS1 = WZ6475000 |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII = GWP218ZY6F |
|
|
| UNII_Comment = (''para'') |
|
|
| UNII2_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII2 = WOI2PSS0KX |
|
|
| UNII2_Comment = (''meta'') |
|
|
| UNII3_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII3 = W5675R7KVW |
|
|
| UNII3_Comment = (''ortho'') |
|
|
| UNII4_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII4 = LFX1C55D2Z |
|
|
| UNII4_Comment = (unspecified) |
|
⚫ |
| SMILES =C1=CC=C(C=C1)C2=CC=C(C=C2)C3=CC=CC=C3 |
|
|
| SMILES2 = c1ccc(cc1)c2ccc(cc2)c3ccccc3 |
|
|
| SMILES2_Comment = (''para'') |
|
|
| InChI = 1/C18H14/c1-3-7-15(8-4-1)17-11-13-18(14-12-17)16-9-5-2-6-10-16/h1-14H |
|
|
| InChI_Comment = (''para'') |
|
|
| InChIKey = XJKSTNDFUHDPQJ-UHFFFAOYAJ |
|
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChI = 1S/C18H14/c1-3-7-15(8-4-1)17-11-13-18(14-12-17)16-9-5-2-6-10-16/h1-14H |
|
|
| StdInChI_Comment = (''para'') |
|
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChIKey = XJKSTNDFUHDPQJ-UHFFFAOYSA-N |
|
}} |
|
}} |
|
|Section2={{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| C=18|H=14 |
|
| C=18 | H=14 |
|
| Appearance=White powder<ref name=chemicalland21> at chemicalland21.com</ref> |
|
| Appearance =White powder<ref name=chemicalland21/> |
|
| Density= |
|
| Density = 1.24 g/cm<sup>3</sup> |
|
|
| MeltingPtC = 212 to 214 |
|
| MeltingPt=212-214 °C<ref name=chemicalland21/><br>212-213 °C<ref name=Sigma> at ]</ref> |
|
| MeltingPt_ref = <ref name=chemicalland21/><br>212-213 °C<ref name=Sigma> at ]</ref> |
⚫ |
| BoilingPt=389 °C<ref name=Sigma/> |
|
|
|
| BoilingPtC = 389 |
⚫ |
| Solubility=Insoluble<ref name=chemicalland21/> |
|
|
⚫ |
| BoilingPt_ref = <ref name=Sigma/> |
|
⚫ |
| Solubility =Insoluble<ref name=chemicalland21/> |
|
|
| RefractIndex = 1.65<ref name="Cryos Beta">{{cite web | url = http://www.cryos-beta.kharkov.ua/organic.php | title = Organic molecular single crystals | publisher = cryos-beta.kharkov.ua }}</ref> |
|
}} |
|
}} |
|
|Section3={{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
|
| MainHazards = |
|
| MainHazards=Iritant ('''Xi''') |
|
|
|
| FlashPtC = 207 |
⚫ |
| FlashPt=207 °C<ref name=Sigma/> |
|
|
⚫ |
| FlashPt_ref = <ref name=Sigma/> |
|
| Autoignition= |
|
|
|
| AutoignitionPt = |
|
| RPhrases = {{R36/37/38}} {{R50/53}} |
|
|
| SPhrases = {{S26}} {{S60}} {{S61}} |
|
| GHSPictograms = {{GHS07}}{{GHS09}} |
|
|
| GHSSignalWord = Warning |
|
|
| HPhrases = {{H-phrases|315|319|335|400}} |
|
|
| PPhrases = {{P-phrases|261|264|271|273|280|302+352|304+340|305+351+338|312|321|332+313|337+313|362|391|403+233|405|501}} |
|
|
| NFPA-H = 2 |
|
|
| NFPA-F = 1 |
|
|
| NFPA-R = 0 |
|
|
| PEL = C 9 mg/m<sup>3</sup> (1 ppm)<ref>{{PGCH|0591}}</ref><ref>{{PGCH|0592}}</ref><ref>{{PGCH|0593}}</ref> |
|
}} |
|
}} |
|
}} |
|
}} |
|
|
|
|
|
'''Terphenyls''' are a group of closely-related ] ]. Also known as '''diphenylbenzenes''' or '''triphenyls''', they consist of a central ] ring substituted with two ]s. The three isomers are ''ortho''-terphenyl, ''meta''-terphenyl, and ''para''-terphenyl. Commercial grade terphenyl is generally a mixture of the three isomers. This mixture is used in the production of ]s, which were formerly used as heat storage and transfer agents.<ref name=chemicalland21/> |
|
'''Terphenyls''' are a group of closely related ]. Also known as '''diphenylbenzenes''' or '''triphenyls''', they consist of a central ] ring substituted with two ]s. There are three ]s: ''ortho''-terphenyl, ], and ''para''-terphenyl. Commercial grade terphenyl is generally a mixture of the three ]s. This mixture is used in the production of ]s, which were formerly used as heat storage and transfer agents.<ref name=chemicalland21> at chemicalland21.com</ref> |
|
|
|
|
''p''-Terphenyl is the most common isomer. It is used as a laser dye and a sunscreen ingredient.<ref name=chemicalland21/> |
|
|
|
|
|
|
|
''p''-Terphenyl derivatives are found in various fungi and bacteria. One example is ], a pigment found in some mushrooms. These natural ''p''-terphenyls are better described as diphenylquinones or diphenylhydroquinones. Some m-terphenyl compounds occur in plants.<ref>{{cite journal |doi=10.1021/cr050248c |title=Natural Terphenyls: Developments since 1877 |date=2006 |last1=Liu |first1=Ji-Kai |journal=Chemical Reviews |volume=106 |issue=6 |pages=2209–2223 |pmid=16771447 }}</ref> |
|
<gallery> |
|
<gallery> |
|
File:ortho-terphenyl.png|''ortho''-Terphenyl |
|
File:ortho-terphenyl.png|''ortho''-Terphenyl |
Line 44: |
Line 96: |
|
|
|
|
|
==See also== |
|
==See also== |
|
* ] |
|
* ] |
|
* ] |
|
* ] |
|
* ] |
|
* ] |
|
|
* ], experimental ] ] that tested terphenyl as reactor coolant |
|
|
|
|
|
==References== |
|
==References== |
Line 53: |
Line 106: |
|
==External links== |
|
==External links== |
|
* at the Oregon Laser Medical Center |
|
* at the Oregon Laser Medical Center |
|
|
* , , at Centers for Disease Control and Prevention, National Institute for Occupational Safety and Health |
|
|
|
|
|
] |
|
] |
|
] |
|
] |
|
|
] |
|
|
|
|
] |
|
|
] |
|