| Revision as of 18:53, 10 February 2011 editEdgar181 (talk | contribs)Extended confirmed users196,325 edits removed Category:Pyranodichromens using HotCat← Previous edit |
Latest revision as of 17:05, 16 July 2021 edit undoJJMC89 bot III (talk | contribs)Bots, Administrators3,706,494 editsm Moving Category:Heterocyclic compounds (5 rings) to Category:Heterocyclic compounds with 5 rings per Misplaced Pages:Categories for discussion/Log/2021 June 24#Category:Heterocyclic compounds (1 ring) |
| (23 intermediate revisions by 14 users not shown) |
| Line 1: |
Line 1: |
|
{{chembox |
|
{{chembox |
|
|
| Verifiedfields = changed |
|
|
| Watchedfields = changed |
|
|
| verifiedrevid = 413150531 |
|
| ImageFile = Tephrosin.png |
|
| ImageFile = Tephrosin.png |
|
| ImageSize = 200px |
|
| ImageSize = 200px |
|
| IUPACName = 7a-Hydroxy-9,10-dimethoxy-3,3-dimethyl-13,13a-dihydro-3''H'',7a''H''-pyranodichromen-7-one |
|
| IUPACName = 7a-Hydroxy-9,10-dimethoxy-3,3-dimethyl-13,13a-dihydro-3''H'',7a''H''-pyranodichromen-7-one |
|
| OtherNames = 12aβ-hydroxydeguelin<ref>{{cite journal| last=Cabizza | first=Maddalena | coauthors=Alberto Angioni, Marinella Melis, Marco Cabras, Carlo V. Tuberoso, and Paolo Cabras | year=2004 | title=Rotenone and rotenoids in cubè resins, formulations, and residues on olives | journal=Journal of Agriculture and Food Chemistry | volume=52 | issue=2 | pages=288–293 | doi=10.1021/jf034987a| pmid=14733510}}</ref> |
|
| OtherNames = 12aβ-hydroxydeguelin<ref>{{cite journal| last=Cabizza | first=Maddalena |author2=Alberto Angioni |author3=Marinella Melis |author4=Marco Cabras |author5=Carlo V. Tuberoso |author6=Paolo Cabras | year=2004 | title=Rotenone and rotenoids in cubè resins, formulations, and residues on olives | journal=Journal of Agricultural and Food Chemistry | volume=52 | issue=2 | pages=288–293 | doi=10.1021/jf034987a| pmid=14733510}}</ref> |
|
| Section1 = {{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
|
| CASNo_Ref = {{cascite|correct|??}} |
|
| CASNo = 76-80-2 |
|
| CASNo = 76-80-2 |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII = 9C081V83CC |
|
|
| ChEBI_Ref = {{ebicite|changed|EBI}} |
|
|
| ChEBI = 9442 |
|
| PubChem = 114909 |
|
| PubChem = 114909 |
|
|
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
|
|
| ChEMBL = 241806 |
|
| SMILES = CC1(C=CC2=C(O1)C=CC3=C2O4COC5=CC(=C(C=C54(C3=O)O)OC)OC)C |
|
| SMILES = CC1(C=CC2=C(O1)C=CC3=C2O4COC5=CC(=C(C=C54(C3=O)O)OC)OC)C |
|
|
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|
|
| ChemSpiderID = 102858 |
|
|
| InChI = 1/C23H22O7/c1-22(2)8-7-12-15(30-22)6-5-13-20(12)29-19-11-28-16-10-18(27-4)17(26-3)9-14(16)23(19,25)21(13)24/h5-10,19,25H,11H2,1-4H3/t19-,23-/m1/s1 |
|
|
| InChIKey = AQBZCCQCDWNNJQ-AUSIDOKSBD |
|
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChI = 1S/C23H22O7/c1-22(2)8-7-12-15(30-22)6-5-13-20(12)29-19-11-28-16-10-18(27-4)17(26-3)9-14(16)23(19,25)21(13)24/h5-10,19,25H,11H2,1-4H3/t19-,23-/m1/s1 |
|
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChIKey = AQBZCCQCDWNNJQ-AUSIDOKSSA-N |
|
|
| RTECS = |
|
|
| MeSHName = |
|
|
| KEGG_Ref = {{keggcite|changed|kegg}} |
|
|
| KEGG = C10535 |
|
}} |
|
}} |
|
| Section2 = {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| Formula = C<sub>23</sub>H<sub>22</sub>O<sub>7</sub> |
|
| Formula = C<sub>23</sub>H<sub>22</sub>O<sub>7</sub> |
|
| MolarMass = 410.41658 g/mol |
|
| MolarMass = 410.41658 g/mol |
| Line 17: |
Line 39: |
|
| BoilingPt = |
|
| BoilingPt = |
|
| Solubility = }} |
|
| Solubility = }} |
|
| Section3 = {{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards = |
|
| MainHazards = |
|
| FlashPt = |
|
| FlashPt = |
|
| Autoignition = }} |
|
| AutoignitionPt = }} |
|
| Section8 = {{Chembox Related |
|
|Section8={{Chembox Related |
|
| OtherAnions = |
|
| OtherAnions = |
|
| OtherCations = |
|
| OtherCations = |
|
| OtherFunctn = |
|
| OtherFunction = |
|
| Function = |
|
| OtherFunction_label = |
|
| OtherCpds = ], ]}} |
|
| OtherCompounds = ], ]}} |
|
}} |
|
}} |
|
|
|
|
|
'''Tephrosin''' is ]. It is a natural fish poison found in the leaves and seeds of '']''<ref>{{cite journal| last=Ahmad | first=V. U. | coauthors=Z. Ali, S. R. Hussaini, F. Iqbal, M. Zahid, M. Abbas, and N. Saba | date=1999-08-01 | title=Flavonoids of ''Tephrosia purpurea'' | journal=Fitoterapia | volume=70 | issue=4 | pages=443–445 | doi=10.1016/S0367-326X(99)00046-5}}</ref> and '']''<ref>Production of rotenoids by heterotrophic and photomixotrophic cell cultures of tephrosia vogelii. Nadine Lambert, Marie-France Trouslot, Claudine Nef-Campa and Hervé Chrestin, Phytochemistry, Volume 34, Issue 6, December 1993, Pages 1515-1520, {{doi|10.1016/S0031-9422(00)90838-0}}</ref>. |
|
'''Tephrosin''' is ]. It is a natural fish poison found in the leaves and seeds of '']''<ref>{{cite journal| last=Ahmad | first=V. U. |author2=Z. Ali |author3=S. R. Hussaini |author4=F. Iqbal |author5=M. Zahid |author6=M. Abbas |author7=N. Saba | date=1999-08-01 | title=Flavonoids of ''Tephrosia purpurea'' | journal=Fitoterapia | volume=70 | issue=4 | pages=443–445 | doi=10.1016/S0367-326X(99)00046-5}}</ref> and '']''.<ref>Production of rotenoids by heterotrophic and photomixotrophic cell cultures of tephrosia vogelii. Nadine Lambert, Marie-France Trouslot, Claudine Nef-Campa and Hervé Chrestin, Phytochemistry, Volume 34, Issue 6, December 1993, Pages 1515-1520, {{doi|10.1016/S0031-9422(00)90838-0}}</ref> |
|
|
|
|
|
|
|
|
|
|
|
==See also== |
|
==See also== |
| Line 43: |
Line 63: |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
|
|
|
|
|
|