Misplaced Pages

Piprozolin: Difference between revisions

Article snapshot taken from Wikipedia with creative commons attribution-sharealike license. Give it a read and then ask your questions in the chat. We can research this topic together.
Browse history interactively
Page 1
Page 2
← Previous editContent deleted Content addedVisualWikitext
Revision as of 00:11, 24 December 2010 editThe chemistds (talk | contribs)Extended confirmed users5,761 edits added chemspider Id← Previous edit Latest revision as of 13:31, 2 April 2023 edit undoEntranced98 (talk | contribs)Extended confirmed users, Pending changes reviewers, Rollbackers174,040 edits Importing Wikidata short description: "Chemical compound"Tag: Shortdesc helper 
(28 intermediate revisions by 21 users not shown)
Line 1: Line 1:
{{Short description|Chemical compound}}
{{unreferenced|date=December 2010}}
{{expand|date=December 2010}}
{{Drugbox {{Drugbox
| Watchedfields = changed
| IUPAC_name = Ethyl (2''Z'')-2-(3-ethyl-4-oxo-5-piperidin-1-yl-1,3-thiazolidin-2-ylidene)acetate
| verifiedrevid = 444056288
| image = Piprozolin.png
| IUPAC_name = Ethyl (2''Z'')-2-(3-ethyl-4-oxo-5-piperidin-1-yl-1,3-thiazolidin-2-ylidene)acetate
| CAS_number = 17243-64-0
| image = Piprozolin.png
| ATC_prefix = A05

| ATC_suffix = AX01
<!--Clinical data-->
| PubChem = 5911905
| CASNo = 63250-48-6 | tradename =
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
| ChemSpiderID = 4744588
| pregnancy_US = <!-- A / B / C / D / X -->
| SMILES = O=C(OCC)\C=C1/SC(C(=O)N1CC)N2CCCCC2
| pregnancy_category =
| StdInChI = 1S/C14H22N2O3S/c1-3-16-11(10-12(17)19-4-2)20-14(13(16)18)15-8-6-5-7-9-15/h10,14H,3-9H2,1-2H3/b11-10-
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled-->
| DrugBank =
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII -->
| C=14|H=22|N=2|O=3|S=1
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C -->
| molecular_weight = 298.40 g/mol
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V -->
| bioavailability =
| protein_bound = | legal_status =
| routes_of_administration =
| metabolism =

| elimination_half-life =
<!--Pharmacokinetic data-->
| excretion =
| bioavailability =
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
| protein_bound =
| pregnancy_US = <!-- A / B / C / D / X -->
| pregnancy_category= | metabolism =
| elimination_half-life =
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled-->
| excretion =
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII -->

| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C -->
<!--Identifiers-->
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V -->
| CAS_number = 17243-64-0
| legal_status =
| ATC_prefix = A05
| routes_of_administration =
| ATC_suffix = AX01
| PubChem = 5911905
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank =
| ChEMBL = 2105231
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 4744588
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 7786W0VV8M

<!--Chemical data-->
| C=14 | H=22 | N=2 | O=3 | S=1
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C14H22N2O3S/c1-3-16-11(10-12(17)19-4-2)20-14(13(16)18)15-8-6-5-7-9-15/h10,14H,3-9H2,1-2H3/b11-10-
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = UAXYBJSAPFTPNB-KHPPLWFESA-N
}} }}


'''Piprozolin''' (or '''piprozoline''') is a ] for ] therapy.<ref>{{cite journal | vauthors = Koss FW, Vollmer KO, Herrmann M | title = | journal = Archives Internationales de Pharmacodynamie et de Therapie | volume = 198 | issue = 2 | pages = 333–46 | date = August 1972 | pmid = 5074733 }}</ref><ref>{{cite web | work = Drugs-about.com | url = http://drugs-about.com/ing/piprozolin.html | title = Piprozolin }}</ref>
'''Piprozolin''' (or '''piprozoline''') is a molecule used in ] therapy.


==Synthesis==
Compared to ], piprozolin shows ] rather than anti-inflammatory activity. That is, the compound is useful in those conditions where the flow of bile is to be increased.
] | gdate = 1976}}</ref>]]
Condensation of ] with ] leads to ] ('''4'''); an intermediate such as '''3''', involving addition of the ] to the nitrile function can reasonably be invoked. M/ethylation with di(m)] proceeds on nitrogen with the concomitant shift of the enamine to afford olefin ('''5'''). Bromination of the active ] ('''6''') followed by displacement of halogen by piperidine affords the ] piprozolin ('''7''').


== References ==
{{reflist}}


{{Bile and liver therapy}} {{Bile and liver therapy}}


] ]
] ]
] ]
] ]



{{gastrointestinal-drug-stub}} {{gastrointestinal-drug-stub}}
Piprozolin: Difference between revisions Add topic