Misplaced Pages

Phosphohydroxypyruvic acid: Difference between revisions

Article snapshot taken from Wikipedia with creative commons attribution-sharealike license. Give it a read and then ask your questions in the chat. We can research this topic together.
Browse history interactively
Page 1
Page 2
← Previous editContent deleted Content addedVisualWikitext
Revision as of 22:41, 7 March 2011 editCWenger (talk | contribs)Extended confirmed users, Pending changes reviewers, Rollbackers20,709 edits Disambiguated: synthesisOrganic synthesis using Dab solver← Previous edit Latest revision as of 16:39, 6 May 2023 edit undoLegionMammal978 (talk | contribs)Extended confirmed users7,894 edits correct IUPAC name 
(18 intermediate revisions by 14 users not shown)
Line 1: Line 1:
{{chembox {{chembox
| Verifiedfields = changed
|ImageFile=Phosphohydroxypyruvic acid.svg
| Watchedfields = changed
|IUPACName=
| verifiedrevid = 417681216
|OtherNames=
| ImageFile = Phosphohydroxypyruvic acid.svg
|Section1= {{Chembox Identifiers
| PIN = 2-Oxo-3-(phosphonooxy)propanoic acid
| CASNo=3913-50-6
| OtherNames =
| PubChem=105
| Section1 = {{Chembox Identifiers
| SMILES=C(C(=O)C(=O)O)OP(=O)(O)O
| CASNo_Ref = {{cascite|correct|CAS}}
| MeSHName=Phosphohydroxypyruvic+acid
| CASNo = 3913-50-6
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = ZX4PWG857L
| PubChem = 105
| SMILES = C(C(=O)C(=O)O)OP(=O)(O)O
| MeSHName = Phosphohydroxypyruvic+acid
| ChEBI_Ref = {{ebicite|changed|EBI}}
| ChEBI = 30933
| InChI = 1S/C3H5O7P/c4-2(3(5)6)1-10-11(7,8)9/h1H2,(H,5,6)(H2,7,8,9)
| InChIKey = LFLUCDOSQPJJBE-UHFFFAOYSA-N
| KEGG_Ref = {{keggcite|changed|kegg}}
| KEGG = C03232
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}
| ChemSpiderID = 103
}} }}
|Section2= {{Chembox Properties | Section2 = {{Chembox Properties
| C = 3 | H = 5 | O = 7 |P = 1
| Formula=C<sub>3</sub>H<sub>5</sub>O<sub>7</sub>P
| Appearance=
| MolarMass=184.041 g/mol
| Appearance= | Density=
| Density= | MeltingPt=
| MeltingPt= | BoilingPt=
| BoilingPt= | Solubility=
| Solubility=
}} }}
|Section3= {{Chembox Hazards | Section3 = {{Chembox Hazards
| MainHazards= | MainHazards=
| FlashPt= | FlashPt=
| AutoignitionPt =
| Autoignition=
}} }}
}} }}

'''Phosphohydroxypyruvic acid''' is an ] in the ] of ].
'''Phosphohydroxypyruvic acid''' is an organic acid most widely known as an ] in the ] of ].<ref>{{cite journal | doi = 10.3389/fpls.2018.00318 | doi-access = free | title = The Glycerate and Phosphorylated Pathways of Serine Synthesis in Plants: The Branches of Plant Glycolysis Linking Carbon and Nitrogen Metabolism | year = 2018 | last1 = Igamberdiev | first1 = Abir U. | last2 = Kleczkowski | first2 = Leszek A. | journal = Frontiers in Plant Science | volume = 9 | page = 318 | pmid = 29593770 | pmc = 5861185 }}</ref>

== Chemical properties ==

Phosphohydroxypyruvic acid is a moderately ].

==References==
{{reflist}}


] ]
Phosphohydroxypyruvic acid: Difference between revisions Add topic