| Revision as of 22:41, 7 March 2011 editCWenger (talk | contribs)Extended confirmed users, Pending changes reviewers, Rollbackers20,709 edits Disambiguated: synthesis → Organic synthesis using Dab solver← Previous edit |
Latest revision as of 16:39, 6 May 2023 edit undoLegionMammal978 (talk | contribs)Extended confirmed users7,894 edits correct IUPAC name |
| (18 intermediate revisions by 14 users not shown) |
| Line 1: |
Line 1: |
|
{{chembox |
|
{{chembox |
|
|
| Verifiedfields = changed |
| ⚫ |
|ImageFile=Phosphohydroxypyruvic acid.svg |
|
|
|
| Watchedfields = changed |
|
|IUPACName= |
|
|
|
| verifiedrevid = 417681216 |
| ⚫ |
|OtherNames= |
|
|
⚫ |
| ImageFile = Phosphohydroxypyruvic acid.svg |
| ⚫ |
|Section1= {{Chembox Identifiers |
|
|
|
| PIN = 2-Oxo-3-(phosphonooxy)propanoic acid |
| ⚫ |
| CASNo=3913-50-6 |
|
|
⚫ |
| OtherNames = |
| ⚫ |
| PubChem=105 |
|
|
⚫ |
| Section1 = {{Chembox Identifiers |
| ⚫ |
| SMILES=C(C(=O)C(=O)O)OP(=O)(O)O |
|
|
|
| CASNo_Ref = {{cascite|correct|CAS}} |
| ⚫ |
| MeSHName=Phosphohydroxypyruvic+acid |
|
|
⚫ |
| CASNo = 3913-50-6 |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII = ZX4PWG857L |
|
⚫ |
| PubChem = 105 |
|
⚫ |
| SMILES = C(C(=O)C(=O)O)OP(=O)(O)O |
|
⚫ |
| MeSHName = Phosphohydroxypyruvic+acid |
|
|
| ChEBI_Ref = {{ebicite|changed|EBI}} |
|
|
| ChEBI = 30933 |
|
|
| InChI = 1S/C3H5O7P/c4-2(3(5)6)1-10-11(7,8)9/h1H2,(H,5,6)(H2,7,8,9) |
|
|
| InChIKey = LFLUCDOSQPJJBE-UHFFFAOYSA-N |
|
|
| KEGG_Ref = {{keggcite|changed|kegg}} |
|
|
| KEGG = C03232 |
|
|
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|
|
| ChemSpiderID = 103 |
|
}} |
|
}} |
|
|Section2= {{Chembox Properties |
|
| Section2 = {{Chembox Properties |
|
|
| C = 3 | H = 5 | O = 7 |P = 1 |
|
| Formula=C<sub>3</sub>H<sub>5</sub>O<sub>7</sub>P |
|
|
|
| Appearance= |
|
| MolarMass=184.041 g/mol |
|
|
| Appearance= |
|
| Density= |
|
| Density= |
|
| MeltingPt= |
|
| MeltingPt= |
|
| BoilingPt= |
|
| BoilingPt= |
|
| Solubility= |
|
| Solubility= |
|
|
}} |
|
}} |
|
|Section3= {{Chembox Hazards |
|
| Section3 = {{Chembox Hazards |
|
| MainHazards= |
|
| MainHazards= |
|
| FlashPt= |
|
| FlashPt= |
|
|
| AutoignitionPt = |
|
| Autoignition= |
|
|
}} |
|
}} |
|
}} |
|
}} |
|
|
|
|
'''Phosphohydroxypyruvic acid''' is an ] in the ] of ]. |
|
|
|
'''Phosphohydroxypyruvic acid''' is an organic acid most widely known as an ] in the ] of ].<ref>{{cite journal | doi = 10.3389/fpls.2018.00318 | doi-access = free | title = The Glycerate and Phosphorylated Pathways of Serine Synthesis in Plants: The Branches of Plant Glycolysis Linking Carbon and Nitrogen Metabolism | year = 2018 | last1 = Igamberdiev | first1 = Abir U. | last2 = Kleczkowski | first2 = Leszek A. | journal = Frontiers in Plant Science | volume = 9 | page = 318 | pmid = 29593770 | pmc = 5861185 }}</ref> |
|
|
|
|
|
== Chemical properties == |
|
|
|
|
|
Phosphohydroxypyruvic acid is a moderately ]. |
|
|
|
|
|
==References== |
|
|
{{reflist}} |
|
|
|
|
|
] |
|
] |