Revision as of 19:34, 20 September 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{drugbox}} (no changed fields - added verified revid - updated 'ChemSpiderID_Ref', 'DrugBank_Ref', 'UNII_Ref', 'ChEMBL_Ref', 'ChEBI_Ref', 'KEGG_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'DrugBank_Ref', 'ChEBI_Ref') per [[WP:CHEMVALID|Chem/Dr← Previous edit |
Latest revision as of 20:56, 2 December 2024 edit undoWikiCleanerBot (talk | contribs)Bots928,113 editsm v2.05b - Bot T5 CW#16 - Fix errors for CW project (Unicode control characters)Tag: WPCleaner |
(70 intermediate revisions by 42 users not shown) |
Line 1: |
Line 1: |
|
|
{{Short description|Stimulant drug of the substituted cathinone class}} |
|
|
{{Redirect|NRG-3|the protein growth factor|Neuregulin 3}} |
|
|
|
|
{{Drugbox |
|
{{Drugbox |
|
|
| Verifiedfields = changed |
⚫ |
| verifiedrevid = 449584422 |
|
|
|
| Watchedfields = changed |
|
⚫ |
| verifiedrevid = 451552327 |
|
| IUPAC_name = (±)-1-(1,3-benzodioxol-5-yl)-2-(methylamino)pentan-1-one |
|
| IUPAC_name = (±)-1-(1,3-benzodioxol-5-yl)-2-(methylamino)pentan-1-one |
|
| image = Pentylone_structure.png |
|
| image = Pentylone.svg |
|
|
|
|
<!--Clinical data--> |
|
|
| tradename = |
|
|
| pregnancy_category = |
|
|
| legal_status = |
|
⚫ |
| routes_of_administration = |
|
|
|
|
|
|
<!--Pharmacokinetic data--> |
|
<!--Clinical data-->| tradename = |
|
| bioavailability = |
|
| pregnancy_category = |
|
|
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled --> |
⚫ |
| protein_bound = |
|
|
| metabolism = |
|
| legal_BR = F2 |
|
|
| legal_BR_comment = <ref>{{Cite web |author=Anvisa |author-link=Brazilian Health Regulatory Agency |date=2023-07-24 |title=RDC Nº 804 - Listas de Substâncias Entorpecentes, Psicotrópicas, Precursoras e Outras sob Controle Especial |trans-title=Collegiate Board Resolution No. 804 - Lists of Narcotic, Psychotropic, Precursor, and Other Substances under Special Control|url=https://www.in.gov.br/en/web/dou/-/resolucao-rdc-n-804-de-24-de-julho-de-2023-498447451 |url-status=live |archive-url=https://web.archive.org/web/20230827163149/https://www.in.gov.br/en/web/dou/-/resolucao-rdc-n-804-de-24-de-julho-de-2023-498447451 |archive-date=2023-08-27 |access-date=2023-08-27 |publisher=] |language=pt-BR |publication-date=2023-07-25}}</ref> |
⚫ |
| elimination_half-life = |
|
|
| excretion = |
|
| legal_DE = Anlage I |
|
|
| legal_UK = Class B |
|
|
|
|
|
| legal_US = Schedule I |
⚫ |
<!--Identifiers--> |
|
|
|
| legal_status = Illegal in Sweden and Finland |
|
⚫ |
| routes_of_administration = <!--Pharmacokinetic data--> |
|
|
| bioavailability = |
|
⚫ |
| protein_bound = |
|
|
| metabolism = |
|
⚫ |
| elimination_half-life = |
|
⚫ |
| excretion = <!--Identifiers--> |
|
|
| CAS_number_Ref = {{cascite|correct|??}} |
|
| CAS_number = 698963-77-8 |
|
| CAS_number = 698963-77-8 |
|
| CAS_supplemental = <BR>17763-01-8 (hydrochloride) |
|
| CAS_supplemental = <BR>17763-01-8 (hydrochloride) |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
| synonyms = β-Keto-Methylbenzodioxolylpentanamine, βk-Methyl-K, βk-MBDP, methylenedioxypentedrone, 1‐(3,4‐methylenedioxyphenyl)‐2‐(methylamino)pentan‐1‐one<ref name="pmid21960541" /> |
|
|
| UNII = IGN39WGH0Q |
|
| ATC_prefix = none |
|
| ATC_prefix = none |
|
| ATC_suffix = |
|
| ATC_suffix = |
|
| PubChem = |
|
| PubChem = 60208608 |
|
|
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|
|
| ChemSpiderID = 29786041 |
|
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChI = 1S/C13H17NO3/c1-3-4-10(14-2)13(15)9-5-6-11-12(7-9)17-8-16-11/h5-7,10,14H,3-4,8H2,1-2H3 |
|
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChIKey = DFMLULIEUUXXSA-UHFFFAOYSA-N |
|
|
|
|
|
<!--Chemical data--> |
|
<!--Chemical data-->| C = 13 |
|
| C=13 | H=17 | N=1 | O=3 |
|
| H = 17 |
|
|
| N = 1 |
|
| molecular_weight = 235.278 g/mol |
|
|
|
| O = 3 |
|
| smiles = c2cc1OCOc1cc2C(=O)C(NC)CCC |
|
| smiles = c2cc1OCOc1cc2C(=O)C(NC)CCC |
|
}} |
|
}} |
|
|
|
|
|
'''β-Keto-Methylbenzodioxolylpentanamine''' ('''Pentylone''', '''bk-Methyl-K''', '''bk-MBDP''') is a ] compound developed in the 1960s,<ref>Substituted phenyl-α-amino ketones. British Patent GB 1085135 (1969).</ref> which has been reported as a novel ], identified in some samples of powders sold as "NRG-1" and "NRG-3", along with varying blends of other ] derivatives including ], ], ] and ].<ref name="pmid21191917">{{cite journal |author=Brandt SD, Freeman S, Sumnall HR, Measham F, Cole J |title=Analysis of NRG 'legal highs' in the UK: identification and formation of novel cathinones |journal=Drug Testing and Analysis |volume= |issue= |pages= |year=2010 |month=December |pmid=21191917 |doi=10.1002/dta.204 |url=}}</ref> |
|
'''Pentylone''' is a ] developed in the 1960s.<ref>{{cite patent | title = Substituted phenyl-α-amino ketones. | country = GB | number = 1085135 | gdate = 1969 }}</ref> It is a ] that has been identified in some samples of powders sold as "NRG-1", along with varying blends of other cathinone derivatives including ], ], ], and ]. |
|
|
It was also found in combination with 4-MePPP being sold as "NRG-3".<ref name="pmid21960541">{{cite journal | vauthors = Brandt SD, Freeman S, Sumnall HR, Measham F, Cole J | title = Analysis of NRG 'legal highs' in the UK: identification and formation of novel cathinones | journal = Drug Testing and Analysis | volume = 3 | issue = 9 | pages = 569–575 | date = September 2011 | pmid = 21960541 | doi = 10.1002/dta.204 }}</ref> Reports indicate side effects include ], ], and ], with effects lasting for several days at high doses.<ref>{{cite journal | vauthors = Bish J |title= Watch Out for Pentylone, the Horrible New MDMA Additive |journal=Vice |date=4 August 2017 |url= https://www.vice.com/en_uk/article/pagjxg/watch-out-for-pentylone-the-horrible-new-mdma-additive}}</ref> |
|
|
|
|
|
==Pharmacology== |
|
|
|
|
|
Pentylone acts as a ] (SNDRI) and a ].<ref>{{cite journal | vauthors = Simmler LD, Rickli A, Hoener MC, Liechti ME | title = Monoamine transporter and receptor interaction profiles of a new series of designer cathinones | journal = Neuropharmacology | volume = 79 | pages = 152–160 | date = April 2014 | pmid = 24275046 | doi = 10.1016/j.neuropharm.2013.11.008 | s2cid = 25259854 }}</ref> |
|
|
|
|
|
==Legality== |
|
|
Pentylone is banned in Canada, Germany, Sweden, the United States, and the United Kingdom.<ref>{{cite web | url=http://www.folkhalsomyndigheten.se/nyheter-och-press/nyhetsarkiv/2014/november/cannabinoider-foreslas-bli-klassade-som-halsofarlig-vara/ | title=Cannabinoider föreslås bli klassade som hälsofarlig vara | trans-title = Cannabinoids are proposed to be classified as a health hazard | archive-url = https://web.archive.org/web/20150325081230/http://www.folkhalsomyndigheten.se/nyheter-och-press/nyhetsarkiv/2014/november/cannabinoider-foreslas-bli-klassade-som-halsofarlig-vara/ | archive-date = 25 March 2015 | language=sv | access-date=29 June 2015 | work = Folkhalsomyndigheten | trans-work = Public Health Agency of Sweden }}</ref><ref>{{cite web | url = https://www.federalregister.gov/articles/2014/03/07/2014-04997/schedules-of-controlled-substances-temporary-placement-of-10-synthetic-cathinones-into-schedule-i | title = Schedules of Controlled Substances: Temporary Placement of 10 Synthetic Cathinones Into Schedule I | publisher = U.S. Federal Register | work = Drug Enforcement Administration | date = 7 March 2014 }}</ref> |
|
|
|
|
|
== See also == |
|
== See also == |
|
* ] |
|
* ] |
|
* ] |
|
* ] |
|
* ] |
|
|
* ] (MDPV) |
|
* ] (MDPV) |
|
* ] |
|
* ] |
|
* ] |
|
* ] |
|
|
* ] |
|
|
|
|
|
== References == |
|
== References == |
|
{{Reflist}} |
|
{{Reflist}} |
|
|
|
|
|
|
|
|
{{Stimulants}} |
|
{{Stimulants}} |
|
{{Adrenergics}} |
|
|
{{Dopaminergics}} |
|
|
{{Serotonergics}} |
|
{{Serotonergics}} |
|
{{Phenethylamines}} |
|
{{Phenethylamines}} |
Line 52: |
Line 74: |
|
] |
|
] |
|
] |
|
] |
|
|
] |
|
|
|
|
|
] |
|
|
] |
|
|
] |
|
|
|
|
|
{{nervous-system-drug-stub}} |
|
{{nervous-system-drug-stub}} |