| Revision as of 18:29, 19 August 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{chembox}} (no changed fields - added verified revid - updated 'ChemSpiderID_Ref', 'DrugBank_Ref', 'ChEMBL_Ref', 'ChEBI_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEBI_Ref') per [[Misplaced Pages:WikiProject Chemicals/Chembox validation|Chem/Drug← Previous edit |
Latest revision as of 08:11, 12 January 2023 edit undoCitation bot (talk | contribs)Bots5,453,693 edits Add: bibcode. | Use this bot. Report bugs. | Suggested by Abductive | Category:Antiinfective agent stubs | #UCB_Category 275/350 |
| (28 intermediate revisions by 21 users not shown) |
| Line 1: |
Line 1: |
|
{{chembox |
|
{{chembox |
|
|
| Verifiedfields = changed |
| ⚫ |
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
|
| Watchedfields = changed |
| ⚫ |
| UNII = 1QS9G4876X |
|
|
| verifiedrevid = 437135543 |
|
| verifiedrevid = 445704445 |
|
|ImageFile=Oxyclozanide.png |
|
| ImageFile=Oxyclozanide.png |
|
|ImageSize=200px |
|
| ImageSize= |
|
|IUPACName=2,3,5-Trichloro-''N''-(3,5-dichloro-2-hydroxyphenyl)-6-hydroxybenzamide |
|
| PIN=2,3,5-Trichloro-''N''-(3,5-dichloro-2-hydroxyphenyl)-6-hydroxybenzamide |
|
|OtherNames= |
|
| OtherNames= |
|
|Section1={{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
|
| CASNo_Ref = {{cascite|correct|??}} |
|
| CASNo=2277-92-1 |
|
| CASNo=2277-92-1 |
|
| PubChem=16779 |
|
| PubChem=16779 |
| ⚫ |
| ATCvet = yes |
|
| ⚫ |
| ATCCode_prefix = P52 |
|
| ⚫ |
| ATCCode_suffix = AG06 |
|
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| KEGG = D08320 |
|
| KEGG = D08320 |
|
| SMILES=C1=C(C=C(C(=C1Cl)O)NC(=O)C2=C(C(=CC(=C2Cl)Cl)Cl)O)Cl |
|
| SMILES=C1=C(C=C(C(=C1Cl)O)NC(=O)C2=C(C(=CC(=C2Cl)Cl)Cl)O)Cl |
|
|
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|
|
| ChemSpiderID = 15904 |
|
|
| InChI = 1/C13H6Cl5NO3/c14-4-1-6(16)11(20)8(2-4)19-13(22)9-10(18)5(15)3-7(17)12(9)21/h1-3,20-21H,(H,19,22) |
|
|
| InChIKey = JYWIYHUXVMAGLG-UHFFFAOYAW |
|
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChI = 1S/C13H6Cl5NO3/c14-4-1-6(16)11(20)8(2-4)19-13(22)9-10(18)5(15)3-7(17)12(9)21/h1-3,20-21H,(H,19,22) |
|
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChIKey = JYWIYHUXVMAGLG-UHFFFAOYSA-N |
|
⚫ |
| UNII_Ref = {{fdacite|correct|FDA}} |
|
⚫ |
| UNII = 1QS9G4876X |
|
}} |
|
}} |
|
|Section2={{Chembox Properties |
|
|Section2={{Chembox Properties |
|
|
| C=13 | H=6 | Cl=5 | N=1 | O=3 |
|
| Formula=C<sub>13</sub>H<sub>6</sub>Cl<sub>5</sub>NO<sub>3</sub> |
|
|
|
| Appearance= |
|
| MolarMass=401.46 g/mol |
|
|
| Appearance= |
|
| Density= |
|
| Density= |
|
| MeltingPt= |
|
| MeltingPt= |
|
| BoilingPt= |
|
| BoilingPt= |
|
| Solubility= |
|
| Solubility= |
|
|
}} |
|
}} |
|
|Section3={{Chembox Hazards |
|
|Section6={{Chembox Pharmacology |
|
⚫ |
| ATCvet = yes |
| ⚫ |
| MainHazards= |
|
|
⚫ |
| ATCCode_prefix = P52 |
| ⚫ |
| FlashPt= |
|
|
⚫ |
| ATCCode_suffix = AG06 |
|
| Autoignition= |
|
|
|
}} |
|
|
|Section7={{Chembox Hazards |
|
⚫ |
| MainHazards= |
|
⚫ |
| FlashPt= |
|
|
| AutoignitionPt= |
|
}} |
|
}} |
|
}} |
|
}} |
|
|
|
|
|
'''Oxyclozanide''' is a ] ]. It is used in the treatment and control of ] in ] mainly domestic animals like Cattle, Sheep and Goats. It mainly acts by uncoupling of Oxidative phosphorylation in flukes.<ref>at ]</ref> |
|
'''Oxyclozanide''' is a ] ]. It is used in the treatment and control of ] in ] mainly domestic animals such as cattle, sheep, and goats. It mainly acts by uncoupling of ] in flukes.<ref>{{PubChem|16779}}</ref> Along with ], another ] drug, it has been recently found to display "strong ''in vivo'' and ''in vitro'' activity against ] (MRSA)".<ref>{{cite journal | doi = 10.1371/journal.pone.0124595| pmid = 25897961| title = Repurposing Salicylanilide Anthelmintic Drugs to Combat Drug Resistant Staphylococcus aureus| journal = PLOS ONE| volume = 10| issue = 4| pages = e0124595| year = 2015| last1 = Rajamuthiah| first1 = Rajmohan| last2 = Fuchs| first2 = Beth Burgwyn| last3 = Conery| first3 = Annie L.| last4 = Kim| first4 = Wooseong| last5 = Jayamani| first5 = Elamparithi| last6 = Kwon| first6 = Bumsup| last7 = Ausubel| first7 = Frederick M.| last8 = Mylonakis| first8 = Eleftherios| pmc=4405337| bibcode = 2015PLoSO..1024595R| doi-access = free}}</ref> |
|
|
|
|
|
|
Sometimes alluded to as "''Pentaclosamide''": CN101891646. |
|
==References== |
|
==References== |
|
|
<ref></ref> |
|
{{reflist}} |
|
{{reflist}} |
|
|
|
|
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
|
|
|
|
|
|
|
{{antiinfective-drug-stub}} |
|
{{antiinfective-drug-stub}} |