| Revision as of 23:47, 30 August 2011 editBogBot (talk | contribs)Bots53,132 edits populated new fields in {{drugbox}} and reordered per bot approval. Report errors and suggestions to User_talk:BogBot← Previous edit |
Latest revision as of 03:35, 21 November 2022 edit undoEntranced98 (talk | contribs)Extended confirmed users, Pending changes reviewers, Rollbackers174,128 edits +sd |
| (18 intermediate revisions by 17 users not shown) |
| Line 1: |
Line 1: |
|
|
{{short description|Chemical compound}} |
|
|
{{Notability|date=April 2015}} |
|
{{Drugbox |
|
{{Drugbox |
|
|
| Watchedfields = changed |
|
| verifiedrevid = 400293012 |
|
| verifiedrevid = 447572878 |
|
| IUPAC_name = (8β)- ''N,N''- diethyl- 1,6-dimethyl- 9,10- didehydroergoline- 8- carboxamide |
|
| IUPAC_name = (8β)-''N'',''N''-Diethyl-1,6-dimethyl-9,10-didehydroergoline-8-carboxamide |
|
| image = MLD-41.svg |
|
| image = MLD-41.svg |
|
|
| width = |
|
|
|
|
|
<!--Clinical data--> |
|
<!--Clinical data--> |
|
| tradename = |
|
| tradename = |
|
| legal_AU = |
|
| legal_AU = |
|
| legal_CA = |
|
| legal_CA = |
|
| legal_UK = |
|
| legal_UK = |
|
| legal_US = |
|
| legal_US = |
|
| routes_of_administration = ] |
|
| routes_of_administration = ] |
|
|
|
|
|
<!--Pharmacokinetic data--> |
|
<!--Pharmacokinetic data--> |
|
| metabolism = hepatic |
|
| metabolism = Hepatic |
|
| excretion = renal |
|
| excretion = Renal |
|
|
|
|
|
<!--Identifiers--> |
|
<!--Identifiers--> |
|
|
| CAS_number_Ref = {{cascite|correct|??}} |
|
| CAS_number = 4238-85-1 |
|
| CAS_number = 4238-85-1 |
|
| PubChem = 165200 |
|
| PubChem = 165200 |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 144824 |
|
| ChemSpiderID = 144824 |
|
⚫ |
| synonyms = MLD-41; N1-Methyl-Lysergic Acid Diethylamide |
|
|
|
|
|
<!--Chemical data--> |
|
<!--Chemical data--> |
|
| C=21 | H=27 | N=3 | O=1 |
|
| C=21 | H=27 | N=3 | O=1 |
|
⚫ |
| SMILES = O=C(N(CC)CC)3/C=C2/c4cccc1c4c(cn1C)C2N(C3)C |
|
| molecular_weight = 337.47 g/mol |
|
| ⚫ |
| smiles = O=C(N(CC)CC)3/C=C2/c4cccc1c4c(cn1C)C2N(C3)C |
|
|
| InChI = 1/C21H27N3O/c1-5-24(6-2)21(25)15-10-17-16-8-7-9-18-20(16)14(12-22(18)3)11-19(17)23(4)13-15/h7-10,12,15,19H,5-6,11,13H2,1-4H3/t15-,19-/m1/s1 |
|
|
| InChIKey = VQZYKSWQIQANKB-DNVCBOLYBR |
|
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/C21H27N3O/c1-5-24(6-2)21(25)15-10-17-16-8-7-9-18-20(16)14(12-22(18)3)11-19(17)23(4)13-15/h7-10,12,15,19H,5-6,11,13H2,1-4H3/t15-,19-/m1/s1 |
|
| StdInChI = 1S/C21H27N3O/c1-5-24(6-2)21(25)15-10-17-16-8-7-9-18-20(16)14(12-22(18)3)11-19(17)23(4)13-15/h7-10,12,15,19H,5-6,11,13H2,1-4H3/t15-,19-/m1/s1 |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = VQZYKSWQIQANKB-DNVCBOLYSA-N |
|
| StdInChIKey = VQZYKSWQIQANKB-DNVCBOLYSA-N |
| ⚫ |
| synonyms = MLD-41, N1- Methyl- Lysergic Acid Diethylamide |
|
|
}} |
|
}} |
|
|
|
|
|
|
'''N1-Methyl-lysergic acid diethylamide''' ('''MLD-41''') is a derivative of ] that has about one-third the psychoactive effects. It has been studied in ] of LSD.<ref>{{cite journal | vauthors = Abramson HA, Rolo A, Sklarofsky B, Stache J | title = Production of cross-tolerance to psychosis-producing doses of lysergic acid diethylamide and psilocybin. | journal = The Journal of Psychology | date = January 1960 | volume = 49 | issue = 1 | pages = 151–4 | doi = 10.1080/00223980.1960.9916396 }}</ref> |
|
'''N1-Methyl-Lysergic Acid Diethylamide''' (MLD-41) is a derivative of ]. The 1-methyl homologue of LSD has more of somatic than sensory effect, has fewer visuals and is less well accepted than LSD, with the range of dosages being from 100 to 300 micrograms. This indicates that it is perhaps a third the potency of LSD which is in accord with both pupillary dilation and reflex action. However, the cardiovascular responses are actually increased. Besides being less potent than LSD, it appears to have a slower onset but it is equally long lived. There is cross-tolerance between MLD-41 and LSD. Hepatic ''N''-demethylation of MLD-41 (1-methyl-LSD)--producing the parent compound ''in vivo'' as a metabolite—may account for both the reduced potency and protracted onset of MLD-41 as a psychedelic. That is, the psychedelic activity of MLD-41 may be partially (or even entirely) due to the formation of LSD as an active metabolite. Metabolism of other 1-methylated-ergoloids to their secondary amine derivatives has been frequently noted in mammals.<ref>Müller-Schweinitzer and Tapparelli (1986). Methylergometrine, an active metabolite of methysergide. ''Cephalalgia''. 6: 35-41.</ref> |
|
|
|
|
|
|
Metabolism of other 1-methylated-ergoloids to their secondary amine derivatives has been frequently noted in mammals.<ref name="pmid3698092">{{cite journal | vauthors = Müller-Schweinitzer E, Tapparelli C | title = Methylergometrine, an active metabolite of methysergide | journal = Cephalalgia: An International Journal of Headache | volume = 6 | issue = 1 | pages = 35–41 | date = March 1986 | pmid = 3698092 | doi = 10.1046/j.1468-2982.1986.0601035.x | s2cid = 5778173 }}</ref> |
|
|
|
|
|
==References== |
|
==References== |
|
{{reflist}} |
|
{{Reflist}} |
|
|
|
|
|
|
{{Hallucinogens}} |
|
{{Hallucinogenic lysergamides}} |
|
|
|
{{Ergolines}} |
|
|
|
|
|
{{DEFAULTSORT:Mld-41}} |
|
{{DEFAULTSORT:Mld-41}} |
| Line 46: |
Line 51: |
|
|
|
|
|
|
|
|
|
{{hallucinogen-stub}} |
|
{{Hallucinogen-stub}} |