| Revision as of 02:58, 27 March 2011 editRjwilmsiBot (talk | contribs)Bots, Pending changes reviewers1,602,950 editsm fixing page range dashes using AWB (7658)← Previous edit |
Latest revision as of 20:23, 31 October 2023 edit undoCitation bot (talk | contribs)Bots5,454,019 edits Add: bibcode, pmc, pmid, page. | Use this bot. Report bugs. | Suggested by Chris Capoccia | #UCB_toolbar |
| (35 intermediate revisions by 17 users not shown) |
| Line 1: |
Line 1: |
|
{{chembox |
|
{{chembox |
|
|
| Verifiedfields = changed |
| ⚫ |
| verifiedrevid = 408631306 |
|
|
|
| Watchedfields = changed |
| ⚫ |
|ImageFile=N(6)-carboxymethyllysine.svg |
|
|
⚫ |
| verifiedrevid = 420918695 |
|
|ImageSize= |
|
|
⚫ |
| ImageFile = N(6)-carboxymethyllysine.svg |
|
|IUPACName=(2''S'')-2-amino-6- (carboxymethylamino)hexanoic acid |
|
|
|
| ImageFile_Ref = {{chemboximage|correct|??}} |
| ⚫ |
|OtherNames= |
|
|
|
| ImageName = Stereo, skeletal formula of N(6)-carboxymethyllysine (S) |
| ⚫ |
|Section1= {{Chembox Identifiers |
|
|
|
| IUPACName = ''N''<sup>6</sup>-(Carboxymethyl)-<small>L</small>-lysine |
| ⚫ |
| CASNo=5746-04-3 |
|
|
|
| SystematicName = (2''S'')-2-Amino-6-hexanoic acid |
| ⚫ |
| PubChem=123800 |
|
|
⚫ |
| OtherNames = |
|
| SMILES=C(CCNCC(=O)O)CC(C(=O)O)N |
|
|
⚫ |
|Section1={{Chembox Identifiers |
| ⚫ |
| MeSHName=N(6)-carboxymethyllysine |
|
|
⚫ |
| CASNo = 5746-04-3 |
| ⚫ |
}} |
|
|
|
| CASNo_Ref = {{cascite|correct|??}} |
| ⚫ |
|Section2= {{Chembox Properties |
|
|
|
| CASNo_Comment = <small>''S''</small> |
|
| Formula=C<sub>8</sub>H<sub>16</sub>N<sub>2</sub>O<sub>4</sub> |
|
|
⚫ |
| PubChem = 15691192 |
|
| MolarMass=204.224 g/mol |
|
|
|
| PubChem1 = 26175690 |
|
| Appearance= |
|
|
|
| PubChem1_Comment = <small>''R''</small> |
|
| Density= |
|
|
|
| PubChem2 = 123800 |
|
| MeltingPt= |
|
|
|
| PubChem2_Comment = <small>''S''</small> |
|
| BoilingPt= |
|
|
|
| ChemSpiderID = 11217184 |
|
| Solubility= |
|
|
|
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
| ⚫ |
}} |
|
|
|
| ChemSpiderID2 = 21467765 |
| ⚫ |
|Section3= {{Chembox Hazards |
|
|
|
| ChemSpiderID2_Ref = {{chemspidercite|changed|chemspider}} |
|
| MainHazards= |
|
|
|
| ChemSpiderID2_Comment = <small>''R''</small> |
|
| FlashPt= |
|
|
|
| ChemSpiderID1 = 110350 |
|
| Autoignition= |
|
|
|
| ChemSpiderID1_Ref = {{chemspidercite|changed|chemspider}} |
| ⚫ |
}} |
|
|
|
| ChemSpiderID1_Comment = <small>''S''</small> |
|
⚫ |
| MeSHName = N(6)-carboxymethyllysine |
|
|
| UNII_Ref = {{fdacite|changed|FDA}} |
|
|
| UNII = 70YDX3Z2O7 |
|
|
| ChEBI = 53014 |
|
|
| ChEBI_Ref = {{ebicite|changed|EBI}} |
|
|
| Beilstein = 4989963 <small>''S''</small> |
|
|
| SMILES = NC(CCCCNCC(=O)O)C(=O)O |
|
|
| StdInChI = 1S/C8H16N2O4/c9-6(8(13)14)3-1-2-4-10-5-7(11)12/h6,10H,1-5,9H2,(H,11,12)(H,13,14) |
|
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChIKey = NUXSIDPKKIEIMI-UHFFFAOYSA-N |
|
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|
⚫ |
}} |
|
⚫ |
|Section2={{Chembox Properties |
|
|
| C=8 | H=16 | N=2 | O=4 |
|
⚫ |
}} |
|
⚫ |
|Section3={{Chembox Related |
|
|
| OtherFunction_label = alkanoic acids |
|
|
| OtherFunction = ] |
|
⚫ |
}} |
|
}} |
|
}} |
|
|
|
|
|
'''N(6)-Carboxymethyllysine''' (CML), also known as N(epsilon)-(carboxymethyl)lysine, is an ] (AGE). CML has been the most used marker for AGEs in food analysis. <ref>{{cite journal | author=Semba RD, Nicklett EJ, Ferrucci L | title=Does accumulation of advanced glycation end products contribute to the aging phenotype? | journal=THE JOURNALS OF GERONTOLOGY | volume=65A | issue=9 | year=2010 | pages=963–975 | id= | pmid=20478906}}</ref> |
|
'''''N''(6)-Carboxymethyllysine''' (CML), also known as ''N''<sup>ε</sup>-(carboxymethyl)lysine, is an ] (AGE). CML has been the most used marker for AGEs in food analysis.<ref>{{cite journal | vauthors=Semba RD, Nicklett EJ, Ferrucci L | title=Does accumulation of advanced glycation end products contribute to the aging phenotype? | journal=The Journals of Gerontology | volume=65A | issue=9 | year=2010 | pages=963–975 | pmid=20478906 | doi=10.1093/gerona/glq074 | pmc=2920582}}</ref> |
|
|
|
|
|
Recently, it has been demonstrated that gut microbiota mediates an aging-associated decline in gut barrier function, allowing AGEs to leak into the bloodstream from the gut and impairing microglial function in the brain. It is suggested that the amount of CML in human blood samples may correlated with age.<ref>{{Cite journal |last=O. Mossad, B. Batut, B. Yilmaz, N. Dokalis, C. Mezö, E. Nent, L. S. Nabavi, M. Mayer, F. J. M. Maron, J. M. Buescher, M. G. de Agüero, A. Szalay, T. Lämmermann, A. J. Macpherson, S. C. Ganal-Vonarburg, R. Backofen, D. Erny, M. Prinz, T. Blank |title=Gut microbiota drives age-related oxidative stress and mitochondrial damage in microglia via the metabolite N6-carboxymethyllysine |journal=Nat. Neurosci. |year= 2022|volume=25 |issue= 3|pages=295–305 |doi=10.1038/s41593-022-01027-3 |pmid=35241804 |s2cid=247228807}}</ref> |
|
|
|
|
|
A humanized monoclonal antibody which binds to N6 – carboxymethyl lysine shows considerable promise as a possible therapeutic agent for treating pancreatic cancer.<ref>{{cite journal |last1=Rossi |first1=Gabriela R. |last2=Jensen |first2=Ashley |last3=Ng |first3=Serina |last4=Yin |first4=Zhirong |last5=Li |first5=Aimin |last6=Misra |first6=Anjan |last7=Von Hoff |first7=Daniel D. |last8=Gruber |first8=Lewis |last9=Gruber |first9=Misty |last10=Han |first10=Haiyong |title=Advanced glycation end product (AGE) targeting antibody SIWA318H is efficacious in preclinical models for pancreatic cancer |journal=Scientific Reports |date=7 October 2023 |volume=13 |issue=1 |page=16953 |doi=10.1038/s41598-023-44211-6 |pmid=37805542 |pmc=10560265 |bibcode=2023NatSR..1316953R }}</ref> |
|
|
|
|
|
==References== |
|
==References== |
|
{{Reflist}} |
|
{{reflist}} |
|
|
|
|
|
{{DEFAULTSORT:Carboxymethyllysine, N(6)-}} |
|
{{DEFAULTSORT:Carboxymethyllysine, N(6)-}} |
|
|
] |
|
] |
|
] |
|
|
] |
|
|
|
|
|
|
|
|
|
{{biochem-stub}} |
|
{{biochem-stub}} |
|
|
|
|
] |
|