| Revision as of 20:33, 1 February 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{drugbox}} (no changed fields - added verified revid - updated 'UNII_Ref', 'ChemSpiderID_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEMBL_Ref', 'KEGG_Ref') per Chem/Drugbox validation (← Previous edit |
Latest revision as of 16:19, 11 January 2025 edit undoArthurfragoso (talk | contribs)Extended confirmed users, Template editors4,591 edits dark mode fix |
| (41 intermediate revisions by 28 users not shown) |
| Line 1: |
Line 1: |
|
|
{{Short description|Chemical compound}} |
| ⚫ |
{{drugbox | verifiedrevid = 410801215 |
|
|
|
{{Drugbox |
|
| |
|
|
|
| Verifiedfields = changed |
| ⚫ |
| IUPAC_name = (5α,6α)-6-methoxy- 17-methyl- 4,5-epoxymorphinan- 3-ol |
|
|
|
| Watchedfields = changed |
|
| image = Dihydroheterocodeine.png |
|
|
⚫ |
| verifiedrevid = 411440855 |
| ⚫ |
| width = 180 |
|
|
⚫ |
| IUPAC_name = (5α,6α)-6,17-Dimethyl-4,5-epoxymorphinan-3,6-diol |
| ⚫ |
| CAS_number = 7732-92-5 |
|
|
|
| image = Methyldihydromorphine.svg |
|
| synonyms = Dihydroheterocodeine |
|
|
|
| image_class = skin-invert-image |
| ⚫ |
| ATC_prefix = none |
|
|
⚫ |
| width = 180 |
| ⚫ |
| ATC_suffix = |
|
|
|
|
| ⚫ |
| PubChem = 5463907 |
|
|
|
<!--Clinical data--> |
| ⚫ |
| DrugBank = |
|
|
|
| tradename = |
| ⚫ |
| C=18 | H=23 | N=1 | O=3 |
|
|
|
| pregnancy_AU = |
|
| molecular_weight = 301.38 g/mol |
|
|
⚫ |
| pregnancy_US = |
|
| smiles = CN1CC2341CC5=C2C(=C(C=C5)O)O3(CC4)OC |
|
|
⚫ |
| pregnancy_category = |
| ⚫ |
| bioavailability = |
|
|
| protein_bound = |
|
| legal_AU = |
|
| metabolism = |
|
| legal_BR = A1 |
|
|
| legal_BR_comment = <ref>{{Cite web |author=Anvisa |author-link=Brazilian Health Regulatory Agency |date=2023-03-31 |title=RDC Nº 784 - Listas de Substâncias Entorpecentes, Psicotrópicas, Precursoras e Outras sob Controle Especial |trans-title=Collegiate Board Resolution No. 784 - Lists of Narcotic, Psychotropic, Precursor, and Other Substances under Special Control|url=https://www.in.gov.br/en/web/dou/-/resolucao-rdc-n-784-de-31-de-marco-de-2023-474904992 |url-status=live |archive-url=https://web.archive.org/web/20230803143925/https://www.in.gov.br/en/web/dou/-/resolucao-rdc-n-784-de-31-de-marco-de-2023-474904992 |archive-date=2023-08-03 |access-date=2023-08-16 |publisher=] |language=pt-BR |publication-date=2023-04-04}}</ref> |
| ⚫ |
| elimination_half-life = |
|
|
⚫ |
| legal_CA = Schedule I |
| ⚫ |
| excretion = |
|
|
| pregnancy_AU = |
|
| legal_UK = |
|
|
| legal_US = Schedule I |
| ⚫ |
| pregnancy_US = |
|
|
|
| legal_DE = Anlage I |
| ⚫ |
| pregnancy_category= |
|
|
⚫ |
| routes_of_administration = |
|
| legal_AU = |
|
|
|
|
|
| legal_CA = |
|
|
|
<!--Pharmacokinetic data--> |
|
| legal_UK = |
|
|
⚫ |
| bioavailability = |
| ⚫ |
| legal_US = Schedule I |
|
|
| legal_status = |
|
| protein_bound = |
|
|
| metabolism = |
| ⚫ |
| routes_of_administration = |
|
|
⚫ |
| elimination_half-life = |
|
⚫ |
| excretion = |
|
|
<!--Identifiers--> |
|
|
| CAS_number_Ref = {{cascite|correct|??}} |
|
⚫ |
| CAS_number = 509-56-8 |
|
⚫ |
| ATC_prefix = none |
|
⚫ |
| ATC_suffix = |
|
⚫ |
| PubChem = 5464303 |
|
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
⚫ |
| DrugBank = |
|
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
|
| KEGG = D12689 |
|
|
| UNII_Ref = {{fdacite|changed|FDA}} |
|
|
| UNII = 26AY9TLO5W |
|
|
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|
|
| ChemSpiderID = 4576611 |
|
|
<!--Chemical data--> |
|
⚫ |
| C=18 | H=23 | N=1 | O=3 |
|
|
| smiles = C1(CC23Cc4ccc(c5c42(1O5)CCN3C)O)O |
|
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChI = 1S/C18H23NO3/c1-17(21)6-5-11-12-9-10-3-4-13(20)15-14(10)18(11,16(17)22-15)7-8-19(12)2/h3-4,11-12,16,20-21H,5-9H2,1-2H3/t11-,12+,16-,17-,18-/m0/s1 |
|
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChIKey = NBKVWIJQJMEQLE-NGTWOADLSA-N |
|
}} |
|
}} |
|
|
|
|
|
'''Methyldihydromorphine''' ('''Dihydroheterocodeine''') is a semi-synthetic ] drug developed in Germany in 1936, controlled under both domestic law and UN conventions because of its possible potential for abuse. Methyldihydromorphine is related to ] and is not a synonym for ], and its structure suggests that it is six to nine times stronger than morphine and 72 times stronger than ]. |
|
'''Methyldihydromorphine'''<ref>{{US Patent| 2104058}}</ref> is a semi-synthetic ] originally developed in Germany in 1936, controlled under both domestic law and UN conventions because of its possible potential for abuse. Methyldihydromorphine is related to ] and is not a synonym for ] or dihydroheterocodeine (6-methoxydihydromorphine). |
|
|
|
|
|
This compound is a derivative of ]<ref name=Randall>{{Cite book | title = Morphine & Allied Drugs | vauthors = Reynolds AK, Randall LO | location = Toronto | publisher = University of Toronto Press | date = 1957 | page = 194}}</ref> It has been found to be 33 percent the analgesic potency of morphine with a substantially longer duration of action.<ref name=Randall/> |
|
|
|
|
|
So far, little is currently known about this compound. It is a Schedule I controlled substance in the United States with an ACSCN of 9304 and a 2013 annual manufacturing quota of 2 grams.<ref>{{cite web | url = http://www.deadiversion.usdoj.gov/fed_regs/quotas/2013/fr0620.htm | title = Quotas - 2013 | work = Drug Enforcement Administration | publisher = United States Department of Justice }}</ref> |
|
|
|
|
|
==References== |
|
==References== |
|
|
{{Reflist}} |
|
|
|
|
|
|
|
|
{{Opioidergics}} |
|
|
|
|
|
] |
|
] |
| ⚫ |
] |
|
|
] |
|
] |
|
] |
|
] |
|
⚫ |
] |
|
] |
|
] |
|
|
|
|