Misplaced Pages

Methyldesorphine: Difference between revisions

Article snapshot taken from Wikipedia with creative commons attribution-sharealike license. Give it a read and then ask your questions in the chat. We can research this topic together.
Browse history interactively
Page 1
Page 2
← Previous editContent deleted Content addedVisualWikitext
Revision as of 20:32, 1 February 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{drugbox}} (no changed fields - added verified revid - updated 'UNII_Ref', 'ChemSpiderID_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEMBL_Ref', 'KEGG_Ref') per Chem/Drugbox validation (← Previous edit Latest revision as of 16:18, 11 January 2025 edit undoArthurfragoso (talk | contribs)Extended confirmed users, Template editors4,591 edits dark mode fix 
(58 intermediate revisions by 31 users not shown)
Line 1: Line 1:
{{Short description|Chemical compound}}
{{drugbox | verifiedrevid = 410801085
{{Drugbox
|
| Verifiedfields = changed
| IUPAC_name = (5α)-6,17-dimethyl- 6,7-didehydro- 4,5-epoxymorphinan- 3-ol
| Watchedfields = changed
| image = Methyldesorphine.png
| verifiedrevid = 411440631
| width = 180
| IUPAC_name = (5α)-6,17-Dimethyl-6,7-didehydro-4,5-epoxymorphinan-3-ol
| CAS_number = 16008-36-9
| image = Methyldesorphine.svg
| synonyms = <small>3-Hydroxy-6,''N''-dimethyl- 4,5-epoxymorphin-6-en</small>
| image_class = skin-invert-image
| ATC_prefix = none
| width = 180
| ATC_suffix =

| PubChem = 5362518
<!--Clinical data-->
| DrugBank =
| tradename =
| C=18 | H=21 | N=1 | O=2
| pregnancy_AU =
| molecular_weight = 283.36 g/mol
| pregnancy_US =
| smiles = CC1=CC23CC4=C52(1OC5=C(C=C4)O)CCN3C
| pregnancy_category =
| bioavailability =
| protein_bound = | legal_AU = S9
| metabolism = | legal_BR = A1
| legal_BR_comment = <ref>{{Cite web |author=Anvisa |author-link=Brazilian Health Regulatory Agency |date=2023-03-31 |title=RDC Nº 784 - Listas de Substâncias Entorpecentes, Psicotrópicas, Precursoras e Outras sob Controle Especial |trans-title=Collegiate Board Resolution No. 784 - Lists of Narcotic, Psychotropic, Precursor, and Other Substances under Special Control|url=https://www.in.gov.br/en/web/dou/-/resolucao-rdc-n-784-de-31-de-marco-de-2023-474904992 |url-status=live |archive-url=https://web.archive.org/web/20230803143925/https://www.in.gov.br/en/web/dou/-/resolucao-rdc-n-784-de-31-de-marco-de-2023-474904992 |archive-date=2023-08-03 |access-date=2023-08-16 |publisher=] |language=pt-BR |publication-date=2023-04-04}}</ref>
| elimination_half-life =
| legal_CA = Schedule I
| excretion =
| pregnancy_AU = | legal_UK =
| legal_US = Schedule I
| pregnancy_US =
| legal_DE = Anlage I
| pregnancy_category=
| routes_of_administration =
| legal_AU =

| legal_CA =
<!--Pharmacokinetic data-->
| legal_UK =
| bioavailability =
| legal_US = Schedule I
| legal_status = | protein_bound =
| metabolism =
| routes_of_administration =
| elimination_half-life =
| excretion =

<!--Identifiers-->
| CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = 16008-36-9
| ATC_prefix = none
| ATC_suffix =
| PubChem = 5362518
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank =
| UNII_Ref = {{fdacite|changed|FDA}}
| UNII = Y460N7W76B
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}
| ChemSpiderID = 4515065
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = D12691

<!--Chemical data-->
| C=18 | H=21 | N=1 | O=2
| smiles = CC1=CC23CC4=C52(1OC5=C(C=C4)O)CCN3C
| StdInChI_Ref = {{stdinchicite|changed|chemspider}}
| StdInChI = 1S/C18H21NO2/c1-10-3-5-12-13-9-11-4-6-14(20)16-15(11)18(12,17(10)21-16)7-8-19(13)2/h3-4,6,12-13,17,20H,5,7-9H2,1-2H3/t12-,13+,17-,18-/m0/s1
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}
| StdInChIKey = CUFWYVOFDYVCPM-GGNLRSJOSA-N
| synonyms = <small>3-Hydroxy-6,''N''-dimethyl- 4,5-epoxymorphin-6-en</small>
}} }}


'''Methyldesorphine''' is an ] analgesic. First synthesized in Germany in 1940 and patented in the US in 1952,<ref>{{cite patent | country = US | number = 2694068 | status = patent | title = Δ6-Desoxymorphine Compounds and Process of Producing the Same | pubdate = 1952-08-05 | gdate = 1954-09-11 | inventor = Payne GB, Pfister III K | assign1 = Merck & Co., Inc. }}</ref> it has a high potential for abuse as with any potent opioid agonist, and is sometimes found along with ] as a component of the home-made opioid mixture known as "Krokodil" used in Russia and the neighboring former Soviet republics.<ref>{{cite journal | vauthors = Savchuk SA, Barsegyan SS, Barsegyan IB, Kolesov GM | s2cid = 195068778 | title = Chromatographic Study of Expert and Biological Samples Containing Desomorphine | doi = 10.1007/s10809-008-4009-5 | journal = Journal of Analytical Chemistry | volume = 63 | issue = 4 | pages = 361–370| year = 2008 }}</ref> It is approximately 15 times more potent than morphine as an analgesic<ref>{{ cite book | vauthors = Casy AF, Parfitt RY | title = Opioid Analgesics, Chemistry and Receptors | year = 1986 | publisher = Plenum Press | location = New York | pages = 37–38 | isbn = 0-306-42130-5 }}</ref><ref>{{cite book | vauthors = Lenz GR, Evans SM, Walters DE, Hopfinger AJ | title = Opiates | year = 1986 | page = 63 | publisher = Academic Press | isbn = 978-0-12-443830-9 }}</ref> but if the 6-7 bond is saturated, the β isomer is some 50 times more potent than morphine.
'''Methyldesorphine''' is an ] analgesic. First synthesized in Germany in 1940, it has a very high potential for abuse.{{fact|date=January 2011}}


Methyldesorphine is listed as a Schedule I Narcotic controlled substance under the Controlled Substances Act 1970 in the United States with a DEA ACSCN of 9302 and zero annual aggregate manufacturing quota. The free base conversion ratio of the hydrochloride is 0.89.<ref>{{cite web | title = Conversion Factors for Controlled Substances | url = http://www.deadiversion.usdoj.gov/quotas/conv_factor/index.html | work = Diversion Control Division | publisher = Drug Enforcement Administration, U.S. Department of Justice }}</ref>
==References==
{{Unreferenced|date=October 2008}}
<references/>


== See also ==
]
* ]
]

== References ==
{{Reflist|2}}

{{Opioidergics}}

]
] ]
] ]
]
]
] ]




{{analgesic-stub}} {{analgesic-stub}}

]
Methyldesorphine: Difference between revisions Add topic