Revision as of 02:52, 11 April 2011 editGrutness (talk | contribs)Autopatrolled, Administrators316,585 editsmNo edit summary← Previous edit |
Latest revision as of 23:06, 4 May 2023 edit undoLegionMammal978 (talk | contribs)Extended confirmed users7,894 edits move systematic name |
(13 intermediate revisions by 13 users not shown) |
Line 1: |
Line 1: |
|
{{chembox |
|
{{chembox |
|
|
| Verifiedfields = changed |
|
| Watchedfields = changed |
|
| Watchedfields = changed |
|
| verifiedrevid = 401005775 |
|
| verifiedrevid = 423447301 |
|
| Name = Melacacidin |
|
| Name = Melacacidin |
|
| ImageFile = Melacacidin.svg |
|
| ImageFile = Melacacidin.svg |
|
| ImageSize = 250px |
|
| ImageSize = 250px |
|
| IUPACName = (2''R'',3''R'',4''R'')-2-(3,4-dihydroxyphenyl)-3,4-dihydro-2H-chromene-3,4,7,8-tetrol |
|
| IUPACName = (2''R'',3''R'',4''R'')-Flavan-3,3′,4,4′,7,8-hexol |
|
|
| SystematicName = (2''R'',3''R'',4''R'')-2-(3,4-Dihydroxyphenyl)-3,4-dihydro-2''H''-1-benzopyran-3,4,7,8-tetrol |
|
| OtherNames = |
|
| OtherNames = |
|
| Section1= {{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
⚫ |
| CASNo = 38081-16-2 |
|
|
|
| CASNo_Ref = {{cascite|correct|??}} |
⚫ |
| PubChem = 169996 |
|
|
⚫ |
| CASNo = 38081-16-2 |
|
| SMILES = C1=CC(=C(C=C1C2C(C(C3=C(O2)C(=C(C=C3)O)O)O)O)O)O |
|
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII = M23MQJ2D23 |
|
⚫ |
| PubChem = 169996 |
|
|
| SMILES = Oc1ccc(cc1O)3Oc2c(O)c(O)ccc2(O)3O |
|
|
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|
|
| ChemSpiderID = 148659 |
|
|
| InChI = 1/C15H14O7/c16-8-3-1-6(5-10(8)18)14-13(21)11(19)7-2-4-9(17)12(20)15(7)22-14/h1-5,11,13-14,16-21H/t11-,13-,14-/m1/s1 |
|
|
| InChIKey = JEUXGAUBSWADEA-MRVWCRGKBR |
|
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChI = 1S/C15H14O7/c16-8-3-1-6(5-10(8)18)14-13(21)11(19)7-2-4-9(17)12(20)15(7)22-14/h1-5,11,13-14,16-21H/t11-,13-,14-/m1/s1 |
|
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChIKey = JEUXGAUBSWADEA-MRVWCRGKSA-N |
|
}} |
|
}} |
|
|Section2= {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| Formula = C<sub>15</sub>H<sub>14</sub>O<sub>7</sub> |
|
| Formula = C<sub>15</sub>H<sub>14</sub>O<sub>7</sub> |
|
| MolarMass = 306.26 g/mol |
|
| MolarMass = 306.26 g/mol |
|
|
| Appearance = |
|
| ExactMass = 306.073953 u |
|
|
| Appearance = |
|
| Density = |
|
| Density = |
|
| MeltingPt = |
|
| MeltingPt = |
|
| BoilingPt = |
|
| BoilingPt = |
|
| Solubility = |
|
| Solubility = |
|
|
}} |
|
}} |
|
|Section3= {{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards= |
|
| MainHazards= |
|
| FlashPt= |
|
| FlashPt= |
|
|
| AutoignitionPt = |
|
| Autoignition= |
|
|
}} |
|
}} |
|
}} |
|
}} |
|
'''Melacacidin''' is a <!-- colorless --> chemical compound related to ]s. It can be found in '']''<ref></ref>. |
|
'''Melacacidin''' is a <!-- colorless --> chemical compound related to ]s. It can be found in '']''.<ref> {{webarchive|url=https://web.archive.org/web/20090805154551/http://www.xolopo.com/agricultural_science/bioactive_phenolic_substances_important_tree_species_15638.html |date=2009-08-05 }}</ref> |
|
|
|
|
|
Melacacidin is a compound that can provoke contact allergy to Australian blackwood '']''<ref></ref>. |
|
Melacacidin is a compound that can provoke contact allergy to Australian blackwood '']''.<ref></ref> |
|
|
|
|
|
<!-- ==Metabolism== |
|
<!-- ==Metabolism== |
Line 42: |
Line 54: |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
|
|
|
|
|
|
|
|
{{Natural-phenol-stub}} |
|
{{Aromatic-stub}} |