Misplaced Pages

Melacacidin: Difference between revisions

Article snapshot taken from Wikipedia with creative commons attribution-sharealike license. Give it a read and then ask your questions in the chat. We can research this topic together.
Browse history interactively
Page 1
Page 2
← Previous editContent deleted Content addedVisualWikitext
Revision as of 02:52, 11 April 2011 editGrutness (talk | contribs)Autopatrolled, Administrators316,585 editsmNo edit summary← Previous edit Latest revision as of 23:06, 4 May 2023 edit undoLegionMammal978 (talk | contribs)Extended confirmed users7,894 edits move systematic name 
(13 intermediate revisions by 13 users not shown)
Line 1: Line 1:
{{chembox {{chembox
| Verifiedfields = changed
| Watchedfields = changed | Watchedfields = changed
| verifiedrevid = 401005775 | verifiedrevid = 423447301
| Name = Melacacidin | Name = Melacacidin
| ImageFile = Melacacidin.svg | ImageFile = Melacacidin.svg
| ImageSize = 250px | ImageSize = 250px
| IUPACName = (2''R'',3''R'',4''R'')-2-(3,4-dihydroxyphenyl)-3,4-dihydro-2H-chromene-3,4,7,8-tetrol | IUPACName = (2''R'',3''R'',4''R'')-Flavan-3,3′,4,4′,7,8-hexol
| SystematicName = (2''R'',3''R'',4''R'')-2-(3,4-Dihydroxyphenyl)-3,4-dihydro-2''H''-1-benzopyran-3,4,7,8-tetrol
| OtherNames = | OtherNames =
| Section1= {{Chembox Identifiers |Section1={{Chembox Identifiers
| CASNo = 38081-16-2
| CASNo_Ref = {{cascite|correct|??}}
| PubChem = 169996
| CASNo = 38081-16-2
| SMILES = C1=CC(=C(C=C1C2C(C(C3=C(O2)C(=C(C=C3)O)O)O)O)O)O
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = M23MQJ2D23
| PubChem = 169996
| SMILES = Oc1ccc(cc1O)3Oc2c(O)c(O)ccc2(O)3O
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}
| ChemSpiderID = 148659
| InChI = 1/C15H14O7/c16-8-3-1-6(5-10(8)18)14-13(21)11(19)7-2-4-9(17)12(20)15(7)22-14/h1-5,11,13-14,16-21H/t11-,13-,14-/m1/s1
| InChIKey = JEUXGAUBSWADEA-MRVWCRGKBR
| StdInChI_Ref = {{stdinchicite|changed|chemspider}}
| StdInChI = 1S/C15H14O7/c16-8-3-1-6(5-10(8)18)14-13(21)11(19)7-2-4-9(17)12(20)15(7)22-14/h1-5,11,13-14,16-21H/t11-,13-,14-/m1/s1
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}
| StdInChIKey = JEUXGAUBSWADEA-MRVWCRGKSA-N
}} }}
|Section2= {{Chembox Properties |Section2={{Chembox Properties
| Formula = C<sub>15</sub>H<sub>14</sub>O<sub>7</sub> | Formula = C<sub>15</sub>H<sub>14</sub>O<sub>7</sub>
| MolarMass = 306.26 g/mol | MolarMass = 306.26 g/mol
| Appearance =
| ExactMass = 306.073953 u
| Appearance = | Density =
| Density = | MeltingPt =
| MeltingPt = | BoilingPt =
| BoilingPt = | Solubility =
| Solubility =
}} }}
|Section3= {{Chembox Hazards |Section3={{Chembox Hazards
| MainHazards= | MainHazards=
| FlashPt= | FlashPt=
| AutoignitionPt =
| Autoignition=
}} }}
}} }}
'''Melacacidin''' is a <!-- colorless --> chemical compound related to ]s. It can be found in '']''<ref></ref>. '''Melacacidin''' is a <!-- colorless --> chemical compound related to ]s. It can be found in '']''.<ref> {{webarchive|url=https://web.archive.org/web/20090805154551/http://www.xolopo.com/agricultural_science/bioactive_phenolic_substances_important_tree_species_15638.html |date=2009-08-05 }}</ref>


Melacacidin is a compound that can provoke contact allergy to Australian blackwood '']''<ref></ref>. Melacacidin is a compound that can provoke contact allergy to Australian blackwood '']''.<ref></ref>


<!-- ==Metabolism== <!-- ==Metabolism==
Line 42: Line 54:
] ]
] ]
] ]




{{Natural-phenol-stub}} {{Aromatic-stub}}
Melacacidin: Difference between revisions Add topic