| Revision as of 12:35, 23 November 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,055 edits Saving copy of the {{chembox}} taken from revid 457275848 of page Lysergol for the Chem/Drugbox validation project (updated: 'CASNo'). |
Latest revision as of 01:13, 4 May 2023 edit LegionMammal978 (talk | contribs)Extended confirmed users7,894 edits add semisystematic name |
| Line 1: |
Line 1: |
|
|
{{Distinguish|Liserdol|Lisuride}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
|
{{chembox |
|
{{Chembox |
|
| Verifiedfields = changed |
|
| Verifiedfields = changed |
|
| verifiedrevid = 415686206 |
|
| verifiedrevid = 462095111 |
|
|ImageFile=lysergol.png |
|
| ImageFile = Lysergol.svg |
|
|ImageSize=150px |
|
| ImageSize = 150px |
|
|IUPACName=(7-Methyl-4,6,6a,7,8,9-hexahydro-indoloquinolin-9-yl)-methanol |
|
| IUPACName = (6-Methyl-9,10-didehydroergolin-8β-yl)methanol |
|
|
| SystematicName = quinolin-9-yl]methanol |
|
|OtherNames= |
|
| OtherNames = |
|
|Section1={{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 14267 |
|
| ChemSpiderID = 14267 |
|
| InChI = 1/C16H18N2O/c1-18-8-10(9-19)5-13-12-3-2-4-14-16(12)11(7-17-14)6-15(13)18/h2-5,7,10,15,17,19H,6,8-9H2,1H3/t10-,15-/m1/s1 |
|
|
| InChIKey = BIXJFIJYBLJTMK-MEBBXXQBBQ |
|
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
| ChEMBL = 39947 |
|
| ChEMBL = 39947 |
| Line 18: |
Line 17: |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = BIXJFIJYBLJTMK-MEBBXXQBSA-N |
|
| StdInChIKey = BIXJFIJYBLJTMK-MEBBXXQBSA-N |
|
| CASNo_Ref = {{cascite|correct|??}} |
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
| CASNo = <!-- blanked - oldvalue: 602-85-7 --> |
|
| CASNo = 1413-67-8 |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
| ⚫ |
| PubChem=14987 |
|
|
|
| UNII = NTR684Z1AZ |
|
⚫ |
| PubChem = 14987 |
|
| IUPHAR_ligand = 123 |
|
| IUPHAR_ligand = 123 |
|
| ChEBI_Ref = {{ebicite|changed|EBI}} |
|
| ChEBI_Ref = {{ebicite|correct|EBI}} |
|
| ChEBI = 60528 |
|
| ChEBI = 60528 |
|
| SMILES = OC3/C=C2/c4cccc1c4c(cn1)C2N(C3)C |
|
| SMILES = OC3/C=C2/c4cccc1c4c(c1)C2N(C3)C |
|
}} |
|
}} |
|
|Section2={{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| Formula=C<sub>16</sub>H<sub>18</sub>N<sub>2</sub>O |
|
| Formula=C<sub>16</sub>H<sub>18</sub>N<sub>2</sub>O |
|
| MolarMass=254.33 g/mol |
|
| MolarMass=254.33 g/mol |
|
| Appearance= |
|
| Appearance= |
|
| Density= |
|
| Density= |
|
| MeltingPt= |
|
| MeltingPt= |
|
| BoilingPt= |
|
| BoilingPt= |
|
| Solubility= |
|
| Solubility= |
|
}} |
|
}} |
|
|Section3={{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards= |
|
| MainHazards= |
|
| FlashPt= |
|
| FlashPt= |
|
|
| AutoignitionPt = |
|
| Autoignition= |
|
|
}} |
|
}} |
|
}} |
|
}} |
|
|
|
|
|
'''Lysergol''' is an ] of the ] family that occurs as a minor constituent in some species of ] (most within '']''), and in the morning glory family of plants (]), including the ] seeds of '']'' (ololiuhqui), '']'' (Hawaiian baby woodrose) and '']''. Lysergol is not a controlled substance in the USA. Its possession and sale is also legal under the U.S. ] because it does not have a known pharmacological action or a precursor relationship to ], which is a controlled substance. However, lysergol is an intermediate in the manufacture of some ergoloid medicines (e.g., ]). |
|
|
|
|
|
Lysergol can be synthesised using a tandem reaction to construct the piperidine skeleton and a rhodium-catalyzed annulation in the late-stage indole formation.<ref name="YuanGuo2017">{{cite journal|last1=Yuan|first1=Haosen|last2=Guo|first2=Zhixian|last3=Luo|first3=Tuoping|title=Synthesis of (+)-Lysergol and Its Analogues To Assess Serotonin Receptor Activity|journal=Organic Letters|year=2017|issn=1523-7060|doi=10.1021/acs.orglett.6b03779}}</ref> |
|
|
|
|
|
== See also == |
|
|
* ] |
|
|
* '']'' |
|
|
|
|
|
==References== |
|
|
{{Reflist}} |
|
|
|
|
|
== External links == |
|
|
* |
|
|
* |
|
|
* |
|
|
* |
|
|
|
|
|
{{Serotonin receptor modulators}} |
|
|
{{Ergolines}} |
|
|
|
|
|
] |
|
|
] |
|
|
|
|
|
|
|
|
{{hallucinogen-stub}} |