Revision as of 18:10, 18 April 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{drugbox}} (no changed fields - added verified revid - updated 'UNII_Ref', 'ChemSpiderID_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEMBL_Ref', 'KEGG_Ref') per Chem/Drugbox validation (← Previous edit |
Latest revision as of 17:02, 17 January 2025 edit undoFswitzer4 (talk | contribs)Extended confirmed users10,886 editsm Added FDA UNII |
(27 intermediate revisions by 18 users not shown) |
Line 1: |
Line 1: |
|
|
{{Short description|Chemical compound}} |
|
{{Drugbox |
|
{{Drugbox |
|
| verifiedrevid = 400123895 |
|
| verifiedrevid = 424722665 |
|
| IUPAC_name = 5-chloro-2-methyl-3-(1,2,3,6-tetrahydro-4-pyridinyl)-1''H''-indole |
|
| IUPAC_name = 5-chloro-2-methyl-3-(1,2,3,6-tetrahydro-4-pyridinyl)-1''H''-indole |
|
| image = EMD386088.png |
|
| image = EMD-386088.svg |
|
|
|
⚫ |
| CAS_number = 54635-62-0 |
|
|
|
<!--Clinical data--> |
⚫ |
| ATC_prefix = none |
|
|
|
| tradename = |
⚫ |
| ATC_suffix = |
|
|
⚫ |
| pregnancy_category = |
⚫ |
| PubChem = 10131112 |
|
|
⚫ |
| legal_status = |
⚫ |
| C = 14 | H = 14 | Cl = 1 | N = 2 |
|
|
⚫ |
| routes_of_administration = |
|
| molecular_weight = 245.727 g/mol |
|
|
|
|
⚫ |
| smiles = Clc2cc1c(cc2)nc(C)c1C=3CCNCC=3 |
|
|
|
<!--Pharmacokinetic data--> |
|
| bioavailability = |
|
| bioavailability = |
|
| metabolism = |
|
| metabolism = |
|
| elimination_half-life = |
|
| elimination_half-life = |
|
| excretion = |
|
| excretion = |
⚫ |
| pregnancy_category = |
|
|
|
|
⚫ |
| legal_status = |
|
|
|
<!--Identifiers--> |
⚫ |
| routes_of_administration = |
|
|
|
| CAS_number_Ref = {{cascite|correct|??}} |
|
⚫ |
| CAS_number = 54635-62-0 |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII = URZ93Y3D9J |
|
⚫ |
| ATC_prefix = none |
|
⚫ |
| ATC_suffix = |
|
⚫ |
| PubChem = 10131112 |
|
|
| ChemSpiderID = 8306627 |
|
|
|
|
|
<!--Chemical data--> |
|
⚫ |
| C=14 | H=14 | Cl=1 | N=2 |
|
⚫ |
| smiles = Clc2cc1c(cc2)c(C)c1C=3CCNCC=3 |
|
|
| StdInChI = 1S/C14H15ClN2/c1-9-14(10-4-6-16-7-5-10)12-8-11(15)2-3-13(12)17-9/h2-4,8,16-17H,5-7H2,1H3 |
|
|
| StdInChIKey = BPPGPYJBCVXILI-UHFFFAOYSA-N |
|
}} |
|
}} |
|
|
|
|
|
'''EMD-386,088''' is an ] derivative which is used in ]. It acts as a ] and ] ] ], with a ] of 1 nM, a significantly higher ] than older 5-HT<sub>6</sub> agonists such as ], although it possesses moderate affinity for the ] as well.<ref>{{cite journal | last1 = Mattsson | first1 = C | last2 = Sonesson | first2 = C | last3 = Sandahl | first3 = A | last4 = Greiner | first4 = HE | last5 = Gassen | first5 = M | last6 = Plaschke | first6 = J | last7 = Leibrock | first7 = J | last8 = Böttcher | first8 = H | title = 2-Alkyl-3-(1,2,3,6-tetrahydropyridin-4-yl)-1H-indoles as novel 5-HT6 receptor agonists | journal = Bioorganic & medicinal chemistry letters | volume = 15 | issue = 19 | pages = 4230–4 | year = 2005 | pmid = 16055331 | doi = 10.1016/j.bmcl.2005.06.067 }}</ref> |
|
'''EMD-386088''' is an ] derivative which is used in ]. It acts as a ] ] ], with a ] of 1 nM, a significantly higher ] than older 5-HT<sub>6</sub> agonists such as ], although it possesses moderate affinity for the ] as well.<ref>{{cite journal | vauthors = Mattsson C, Sonesson C, Sandahl A, Greiner HE, Gassen M, Plaschke J, Leibrock J, Böttcher H | display-authors = 6 | title = 2-Alkyl-3-(1,2,3,6-tetrahydropyridin-4-yl)-1H-indoles as novel 5-HT6 receptor agonists | journal = Bioorganic & Medicinal Chemistry Letters | volume = 15 | issue = 19 | pages = 4230–4234 | date = October 2005 | pmid = 16055331 | doi = 10.1016/j.bmcl.2005.06.067 }}</ref> Subsequent research has determined that EMD-386088 is also a ] and that this action is involved in the ]-like effects of the drug in rodents.<ref name="pmid27106213">{{cite journal | vauthors = Jastrzębska-Więsek M, Siwek A, Partyka A, Antkiewicz-Michaluk L, Michaluk J, Romańska I, Kołaczkowski M, Wesołowska A | display-authors = 6 | title = Study of a mechanism responsible for potential antidepressant activity of EMD 386088, a 5-HT6 partial agonist in rats | journal = Naunyn-Schmiedeberg's Archives of Pharmacology | volume = 389 | issue = 8 | pages = 839–849 | date = August 2016 | pmid = 27106213 | pmc = 4939156 | doi = 10.1007/s00210-016-1245-3 }}</ref> |
|
|
|
|
|
EMD-386088 can be further reacted with a butyrophenone sidechain.<ref>Genus Possanza, Kurt Freter, & Sven Luttke, {{US patent|3980658}} (1976 to Boehringer Ingelheim GmbH).</ref> |
|
|
|
|
|
== See also == |
|
== See also == |
|
* ] |
|
* ] |
|
|
* ] |
|
|
|
|
|
== References == |
|
== References == |
|
{{Reflist}} |
|
{{Reflist}} |
|
|
|
|
|
|
{{Dopamine receptor modulators}} |
|
{{Serotonergics}} |
|
|
|
{{Serotonin receptor modulators}} |
|
|
|
|
|
⚫ |
] |
|
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
|
|
⚫ |
] |
|
|
|
{{Nervous-system-drug-stub}} |