Revision as of 10:40, 17 November 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,055 edits Saving copy of the {{drugbox}} taken from revid 456757461 of page Dyclonine for the Chem/Drugbox validation project (updated: 'DrugBank', 'ChEMBL'). |
Latest revision as of 00:33, 18 February 2024 edit InternetArchiveBot (talk | contribs)Bots, Pending changes reviewers5,388,257 edits Rescuing 1 sources and tagging 0 as dead.) #IABot (v2.0.9.5 |
Line 1: |
Line 1: |
|
|
{{short description|Anesthetic}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
|
{{Drugbox |
|
{{Drugbox |
|
| Verifiedfields = changed |
|
| Verifiedfields = changed |
|
| verifiedrevid = 406008143 |
|
| verifiedrevid = 461091735 |
|
| IUPAC_name = 1-(4-butoxyphenyl)-3-(1-piperidyl)propan-1-one |
|
| IUPAC_name = 1-(4-butoxyphenyl)-3-(1-piperidyl)propan-1-one |
|
| image = Dyclonine.png |
|
| image = Dyclonine Structural Formula V.1.svg |
|
|
|
|
<!--Clinical data--> |
|
<!--Clinical data--> |
|
| tradename = Sucrets |
|
| tradename = Sucrets |
|
| Drugs.com = {{drugs.com|monograph|dyclonine-hydrochloride}} |
|
| Drugs.com = {{drugs.com|monograph|dyclonine-hydrochloride}} |
|
| pregnancy_category = |
|
| pregnancy_US = C |
|
| legal_status = |
|
| legal_US = OTC |
|
| routes_of_administration = |
|
| routes_of_administration = Lozenge |
|
|
|
|
<!--Pharmacokinetic data--> |
|
<!--Pharmacokinetic data--> |
|
| bioavailability = |
|
| bioavailability = |
|
| protein_bound = |
|
| protein_bound = |
|
| metabolism = |
|
| metabolism = |
|
| elimination_half-life = |
|
| elimination_half-life = |
|
|
|
|
<!--Identifiers--> |
|
<!--Identifiers--> |
|
|
| IUPHAR_ligand = 7173 |
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
|
| CAS_number_Ref = {{cascite|correct|??}} |
|
| CAS_number_Ref = {{cascite|correct|??}} |
|
| CAS_number = 586-60-7 |
|
| CAS_number = 586-60-7 |
Line 35: |
Line 32: |
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| KEGG = D07881 |
|
| KEGG = D07881 |
|
| ChEBI_Ref = {{ebicite|changed|EBI}} |
|
| ChEBI_Ref = {{ebicite|correct|EBI}} |
|
| ChEBI = 4724 |
|
| ChEBI = 4724 |
|
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
|
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
|
| ChEMBL = <!-- blanked - oldvalue: 1201217 --> |
|
| ChEMBL = 1201217 |
|
|
<!--Chemical data--> |
|
| C=18 | H=27 | N=1 | O=2 |
|
| C=18 | H=27 | N=1 | O=2 |
|
| molecular_weight = 289.413 g/mol |
|
|
| smiles = O=C(c1ccc(OCCCC)cc1)CCN2CCCCC2 |
|
| smiles = O=C(c1ccc(OCCCC)cc1)CCN2CCCCC2 |
|
| InChI = 1/C18H27NO2/c1-2-3-15-21-17-9-7-16(8-10-17)18(20)11-14-19-12-5-4-6-13-19/h7-10H,2-6,11-15H2,1H3 |
|
|
| InChIKey = BZEWSEKUUPWQDQ-UHFFFAOYAN |
|
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/C18H27NO2/c1-2-3-15-21-17-9-7-16(8-10-17)18(20)11-14-19-12-5-4-6-13-19/h7-10H,2-6,11-15H2,1H3 |
|
| StdInChI = 1S/C18H27NO2/c1-2-3-15-21-17-9-7-16(8-10-17)18(20)11-14-19-12-5-4-6-13-19/h7-10H,2-6,11-15H2,1H3 |
Line 49: |
Line 44: |
|
| StdInChIKey = BZEWSEKUUPWQDQ-UHFFFAOYSA-N |
|
| StdInChIKey = BZEWSEKUUPWQDQ-UHFFFAOYSA-N |
|
}} |
|
}} |
|
|
|
|
|
'''Dyclonine''' ('''Dyclocaine''') is an oral ] that is the active ingredient of '''Sucrets''', an ] ].<ref>{{cite encyclopedia |author=Janice Jorgensen |encyclopedia= Encyclopedia of Consumer Brands: Personal products |title=Sucrets |url=https://books.google.com/books?id=cNQbAAAAIAAJ&pg=PA525 |isbn= 9781558623378|year=1994 |publisher=] | access-date=2011-09-24 }}</ref> It is also found in some varieties of the ] ] spray. It is a local anesthetic, used topically as the hydrochloride salt.<ref>{{cite journal | vauthors = Gargiulo AV, Burns GM, Huck CP | title = Dyclonine hydrochloride--a topical agent for managing pain | journal = Illinois Dental Journal | volume = 61 | issue = 4 | pages = 303–4 | year = 1992 | pmid = 1286862 }}</ref> |
|
|
|
|
|
==History== |
|
|
The product Sucrets was introduced in ], by ] in 1932.<ref name=tin/> |
|
|
|
|
|
In 1966 the ] ordered ] to discontinue the ]s of germ-killing and pain-relieving properties for its Sucrets and Children's Sucrets throat lozenges.<ref>{{cite news |title=F.T.C. Bids Merck Halt Claims That Lozenges Will Kill Germs |url=https://select.nytimes.com/gst/abstract.html?res=FA0C15F63F58107B93C2AB178FD85F428685F9 |agency=] |work=] |date=April 19, 1966 |access-date=2011-09-24 }}</ref> In 1977, it was acquired by ], later merging with ] in 1989 to form SmithKline Beecham. By 1994 the brand switched from a metal container to a ].<ref name=tin>{{cite news |title=The Sucrets tin joins the age of plastics |url=https://pqasb.pqarchiver.com/USAToday/access/55245690.html?dids=55245690:55245690&FMT=ABS&FMTS=ABS:FT&type=current&date=Jul+19%2C+1994&author=Michelle+Healy&pub=USA+TODAY+(pre-1997+Fulltext)&desc=The+Sucrets+tin+joins+the+age+of+plastics&pqatl=google |newspaper=] |date=July 19, 1994 |access-date=2011-09-24 |archive-date=2017-08-22 |archive-url=https://web.archive.org/web/20170822221441/http://www.pqarchiver.com/titles?dids=55245690:55245690&FMT=ABS&FMTS=ABS:FT&type=current&date=Jul+19%2C+1994&author=Michelle+Healy&pub=USA+TODAY+(pre-1997+Fulltext)&desc=The+Sucrets+tin+joins+the+age+of+plastics&pqatl=google |url-status=dead }}</ref> |
|
|
SmithKline Beecham, after announcing a merger with GlaxoWellcome to form ], sold the brand in 2000 to ]. In 2011, Sucrets reintroduced their product back into the familiar tin due to popular demand and nostalgia. |
|
|
|
|
|
== See also == |
|
|
* ] |
|
|
|
|
|
== References == |
|
|
{{reflist}} |
|
|
|
|
|
== External links == |
|
|
* |
|
|
|
|
|
{{Throat preparations}} |
|
|
|
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
|
|
|
|
|
|
{{respiratory-system-drug-stub}} |
|
|
{{nervous-system-drug-stub}} |