| Revision as of 13:38, 12 May 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{chembox}} (no changed fields - added verified revid - updated 'UNII_Ref', 'ChemSpiderID_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEMBL_Ref', 'KEGG_Ref') per Chem/Drugbox validation (← Previous edit |
Latest revision as of 14:23, 19 March 2024 edit undoTautropfli (talk | contribs)149 editsm Use of Unbulleted list macro for OtherNames property of Chembox as is the recommendation in the docs.Tag: 2017 wikitext editor |
| (13 intermediate revisions by 9 users not shown) |
| Line 1: |
Line 1: |
|
{{Chembox |
|
{{Chembox |
|
|
| Verifiedfields = changed |
| ⚫ |
| verifiedrevid = 346345278 |
|
|
|
| Watchedfields = changed |
|
⚫ |
| verifiedrevid = 428752589 |
|
| ImageFile = Dipotassium guanylate.png |
|
| ImageFile = Dipotassium guanylate.png |
|
| ImageSize = 200px |
|
| ImageSize = 200px |
|
| ImageAlt = |
|
| ImageAlt = |
|
| IUPACName = |
|
| IUPACName = Dipotassium 5′-guanylate |
|
|
| SystematicName = Dipotassium methyl phosphate |
|
| OtherNames = 5'-Guanosine monophosphate dipotassium salt; 5'-Guanylic acid dipotassium salt; E628 |
|
| OtherNames = {{Unbulleted list|5′-Guanosine monophosphate dipotassium salt|5′-Guanylic acid dipotassium salt|E628}} |
|
| Section1 = {{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
| ⚫ |
| CASNo = 3254-39-5 |
|
|
|
| CASNo_Ref = {{cascite|correct|??}} |
| ⚫ |
| PubChem = |
|
|
⚫ |
| CASNo = 3254-39-5 |
| ⚫ |
| SMILES = O1(O)(N2C=NC3=C2NC(N)=NC3=O)O1COP()()=O.. |
|
|
|
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|
|
| ChemSpiderID = 18598953 |
|
⚫ |
| PubChem = 22841446 |
|
|
| EC_number = 221-849-5 |
|
|
| UNII = R87C8160YV |
|
|
| InChI = 1/C10H14N5O8P.2K/c11-10-13-7-4(8(18)14-10)12-2-15(7)9-6(17)5(16)3(23-9)1-22-24(19,20)21;;/h2-3,5-6,9,16-17H,1H2,(H2,19,20,21)(H3,11,13,14,18);;/q;2*+1/p-2/t3-,5-,6-,9-;;/m1../s1 |
|
|
| InChIKey = BCQFRUIIFOQGFI-QZORJYQDBD |
|
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChI = 1S/C10H14N5O8P.2K/c11-10-13-7-4(8(18)14-10)12-2-15(7)9-6(17)5(16)3(23-9)1-22-24(19,20)21;;/h2-3,5-6,9,16-17H,1H2,(H2,19,20,21)(H3,11,13,14,18);;/q;2*+1/p-2/t3-,5-,6-,9-;;/m1../s1 |
|
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChIKey = BCQFRUIIFOQGFI-LGVAUZIVSA-L |
|
⚫ |
| SMILES = O1(O)(N2C=NC3=C2NC(N)=NC3=O)O1COP()()=O.. |
|
}} |
|
}} |
|
| Section2 = {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| C=10 | H=12 | K=2 | N=5 | O=8 | P=1 |
|
| C=10 | H=12 | K=2 | N=5 | O=8 | P=1 |
|
| Appearance = |
|
| Appearance = |
|
| Density = |
|
| Density = |
|
| MeltingPt = |
|
| MeltingPt = |
|
| BoilingPt = |
|
| BoilingPt = |
|
| Solubility = }} |
|
| Solubility = }} |
|
| Section3 = {{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards = |
|
| MainHazards = |
|
| FlashPt = |
|
| FlashPt = |
|
| Autoignition = }} |
|
| AutoignitionPt = }} |
|
}} |
|
}} |
|
|
|
|
|
'''Dipotassium guanylate''' is a ] with formula K<sub>2</sub>(C<sub>10</sub>H<sub>12</sub>O<sub>4</sub>N<sub>5</sub>PO<sub>4</sub>). It is a ] ] of ]. |
|
'''Dipotassium guanylate''' is a ] with formula K<sub>2</sub>(C<sub>10</sub>H<sub>12</sub>O<sub>4</sub>N<sub>5</sub>PO<sub>4</sub>). It is a ] ] of ].<ref name=faie/> |
|
|
|
|
|
|
As a food additive, it is used as a ] and has the ] E628.<ref name=faie>{{cite book |author1=Nordic Council of Ministers |title=Food Additives in Europe 2000: Status of Safety Assessments of Food Additives Presently Permitted in the EU. |date=2002 |publisher=Nordic Council of Ministers |isbn=9789289308298 |pages=559–561 |url=https://books.google.com/books?id=Fvm-sqd90-oC&pg=PA559 |language=en}}</ref> |
|
As a food additive, it is used as a ] and has the ] E628. |
|
|
|
|
|
|
|
==References== |
|
|
|
|
|
{{Reflist}} |
| ⚫ |
{{organic-compound-stub}} |
|
|
|
|
|
|
] |
|
] |
|
] |
|
] |
|
|
] |
|
|
|
|
|
|
|
⚫ |
{{organic-compound-stub}} |