| Revision as of 16:25, 7 August 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{chembox}} (no changed fields - added verified revid - updated 'DrugBank_Ref', 'UNII_Ref', 'ChEMBL_Ref', 'ChEBI_Ref', 'KEGG_Ref') per Chem/Drugbox validation (report [[Wikipedia_talk:Wi← Previous edit |
Latest revision as of 14:18, 30 April 2023 edit undoLegionMammal978 (talk | contribs)Extended confirmed users7,894 edits move systematic name |
| (13 intermediate revisions by 11 users not shown) |
| Line 1: |
Line 1: |
|
|
{{short description|Chemical compound}} |
|
|
{{refimprove|date=May 2021}} |
|
{{DISPLAYTITLE:''cis''-Inositol}} |
|
{{DISPLAYTITLE:''cis''-Inositol}} |
|
{{Chembox |
|
{{Chembox |
|
|
| Watchedfields = changed |
|
| verifiedrevid = 443526375 |
|
| verifiedrevid = 449558422 |
|
| ImageFile = Cis-inositol.svg |
|
| ImageFile = Cis-inositol.svg |
|
| ImageSize = |
|
| ImageSize = |
|
| Name = ''cis''-Inositol |
|
| Name = ''cis''-Inositol |
|
|
| IUPACName = ''cis''-Inositol<ref>{{cite book |author=] |date=2014 |title=Nomenclature of Organic Chemistry: IUPAC Recommendations and Preferred Names 2013 |publisher=] |pages=1415 |doi=10.1039/9781849733069 |isbn=978-0-85404-182-4}}</ref> |
|
| IUPACName = |
|
|
|
| SystematicName = (1''s'',2''s'',3''s'',4''s'',5''s'',6''s'')-Cyclohexane-1,2,3,4,5,6-hexol |
|
| OtherNames = |
|
| OtherNames = |
|
| Section1 = {{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
|
| CASNo_Ref = {{cascite|correct|??}} |
|
| CASNo = 488-59-5 |
|
|
| PubChem = |
|
| CASNo = 488-59-5 |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII = 1VS4X81277 |
|
|
| PubChem = |
|
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 16736992 |
|
| ChemSpiderID = 16736992 |
|
| ChEBI_Ref = {{ebicite|correct|EBI}} |
|
| ChEBI_Ref = {{ebicite|correct|EBI}} |
|
| ChEBI = 23311 |
|
| ChEBI = 23311 |
|
| SMILES = O1(O)(O)(O)(O)1O |
|
| SMILES = O1(O)(O)(O)(O)1O |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI=1S/C6H12O6/c7-1-2(8)4(10)6(12)5(11)3(1)9/h1-12H/t1-,2+,3-,4+,5-,6+ |
|
| StdInChI=1S/C6H12O6/c7-1-2(8)4(10)6(12)5(11)3(1)9/h1-12H/t1-,2+,3-,4+,5-,6+ |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = CDAISMWEOUEBRE-JMVOWJSSSA-N |
|
| StdInChIKey = CDAISMWEOUEBRE-JMVOWJSSSA-N |
|
}} |
|
}} |
|
| Section2 = {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| C=6|H=12|O=6 |
|
| C=6 | H=12 | O=6 |
|
| Appearance = |
|
| Appearance = |
|
| Density = |
|
| Density = |
| Line 27: |
Line 34: |
|
| BoilingPt = |
|
| BoilingPt = |
|
| Solubility = }} |
|
| Solubility = }} |
|
| Section3 = {{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards = |
|
| MainHazards = |
|
| FlashPt = |
|
| FlashPt = |
|
| Autoignition = }} |
|
| AutoignitionPt = }} |
|
}} |
|
}} |
|
|
|
|
| Line 43: |
Line 50: |
|
*] |
|
*] |
|
*] |
|
*] |
|
|
*] |
|
|
|
|
|
|
==References== |
|
|
{{Reflist}} |
|
|
|
|
|
{{DEFAULTSORT:Inositol, cis-}} |
|
{{DEFAULTSORT:Inositol, cis-}} |
| ⚫ |
{{pharma-stub}} |
|
|
|
|
|
] |
|
] |
|
|
|
|
|
|
|
⚫ |
{{alcohol-stub}} |