| Revision as of 18:59, 6 August 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,055 edits Script assisted update of identifiers for the Chem/Drugbox validation project (updated: 'UNII', 'ChEBI').← Previous edit |
Latest revision as of 22:36, 10 January 2025 edit undoArthurfragoso (talk | contribs)Extended confirmed users, Template editors4,591 edits dark mode fix |
| (36 intermediate revisions by 25 users not shown) |
| Line 1: |
Line 1: |
|
{{chembox |
|
{{chembox |
|
| Watchedfields = changed |
|
| Watchedfields = changed |
|
| verifiedrevid = 413864023 |
|
| verifiedrevid = 443387760 |
|
| ImageFile_Ref = {{chemboximage|correct|??}} |
|
| ImageFile_Ref = {{chemboximage|correct|??}} |
|
| ImageFile = Ampyrone structure.png |
|
| ImageFile = Ampyrone structure.png |
|
|
| ImageClass = skin-invert-image |
|
| ImageSize = |
|
| ImageSize = |
|
|
| PIN = 4-Amino-1,5-dimethyl-2-phenyl-3''H''-pyrazol-3-one<ref>{{Cite web|last=PubChem|title=4-Aminoantipyrine|date=25 March 2005|url=https://pubchem.ncbi.nlm.nih.gov/compound/2151#section=IUPAC-Name|access-date=2022-05-09|website=PubChem|language=en}}</ref> |
|
| IUPACName = 4-Amino- 1,5-dimethyl- 2-phenyl- pyrazol- 3-one |
|
|
| OtherNames = solvapyrin A, aminoazophene, aminoantipyrene, metapyrazone |
|
| OtherNames = solvapyrin A, aminoazophene, aminoantipyrene, aminoantipyrine, metapyrazone |
|
| Section1 = {{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
| InChI = 1/C11H13N3O/c1-8-10(12)11(15)14(13(8)2)9-6-4-3-5-7-9/h3-7H,12H2,1-2H3 |
|
| InChI = 1/C11H13N3O/c1-8-10(12)11(15)14(13(8)2)9-6-4-3-5-7-9/h3-7H,12H2,1-2H3 |
|
| InChIKey = RLFWWDJHLFCNIJ-UHFFFAOYAT |
|
| InChIKey = RLFWWDJHLFCNIJ-UHFFFAOYAT |
| Line 21: |
Line 22: |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 2066 |
|
| ChemSpiderID = 2066 |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII = 0M0B7474RA |
|
| UNII = 0M0B7474RA |
|
|
| ChEBI_Ref = {{ebicite|correct|EBI}} |
|
| ChEBI = 59026 |
|
| ChEBI = 59026 |
|
| SMILES = O=C2\C(=C(/N(N2c1ccccc1)C)C)N |
|
| SMILES = O=C2\C(=C(/N(N2c1ccccc1)C)C)N |
|
}} |
|
}} |
|
| Section2 = {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| C=11 | H=13 | N=3 | O=1 |
|
| C=11 | H=13 | N=3 | O=1<ref name="PubChem"/> |
|
| MolarMass = 203.24 g/mol |
|
| MolarMass = 203.24 g/mol |
|
| Appearance = |
|
| Appearance = |
|
| Density = 1.207g/cm<sup>3</sup> |
|
| Density = 1.207g/cm<sup>3</sup> |
|
| MeltingPt = 106-110°C |
|
| MeltingPtC = 106 to 110 |
|
|
| MeltingPt_notes = |
|
| BoilingPt = 309°C @760mmHg |
|
|
|
| BoilingPtC = 309 |
|
|
| BoilingPt_notes = @760mmHg |
|
| Solubility = }} |
|
| Solubility = }} |
|
| Section3 = {{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards = |
|
| MainHazards = |
|
| FlashPt = 140.7°C |
|
| FlashPtC = 140.7 |
|
| Autoignition = }} |
|
| AutoignitionPtC = |
|
|
}} |
|
}} |
|
}} |
|
|
|
|
|
'''Ampyrone''' is a ] of ] with ], ], and ] properties. Due to the risk of ] its use as a ] is discouraged.<ref>Instead it is used as a ] for ] reactions producing ]s or ]. Ampyrone stimulates ] ]s and is also used to measure ] water. |
|
'''Ampyrone''' is a ] of ] with ], ], and ] properties.<ref name="PubChem"/> While the parent ], aminopyrine, has been discouraged due to the risk of ],<ref>{{Cite journal |last=Bailey |first=D. N. |date=1983 |title=The unusual occurrence of 4-aminoantipyrine (4-aminophenazone) in human biological fluids |url=https://pubmed.ncbi.nlm.nih.gov/6855207/ |journal=Journal of Analytical Toxicology |volume=7 |issue=2 |pages=76–78 |doi=10.1093/jat/7.2.76 |issn=0146-4760 |pmid=6855207}}</ref><ref>{{Cite web |last=PubChem |title=Aminopyrine |url=https://pubchem.ncbi.nlm.nih.gov/compound/6009 |access-date=2024-08-26 |website=pubchem.ncbi.nlm.nih.gov |language=en}}</ref> ampyrone itself has significantly lower toxicity.<ref>{{Cite web |last=PubChem |title=4-Aminoantipyrine |url=https://pubchem.ncbi.nlm.nih.gov/compound/2151 |access-date=2024-08-26 |website=pubchem.ncbi.nlm.nih.gov |language=en}}</ref> It is used as a ] for ] reactions producing ]s or ].<ref name="PubChem">{{Cite web|date=25 March 2005|title=4-Aminoantipyrine|url=https://pubchem.ncbi.nlm.nih.gov/compound/2151#:~:text=A%20metabolite%20of%20AMINOPYRINE%20with,water|access-date=2022-05-09|website=pubchem.ncbi.nlm.nih.gov|language=en}}</ref> Ampyrone stimulates ] ]s and is also used to measure ] water.<ref name="PubChem"/> |
|
|
|
|
|
==References== |
|
==References== |
| Line 45: |
Line 51: |
|
|
|
|
|
{{Anti-inflammatory and antirheumatic products}} |
|
{{Anti-inflammatory and antirheumatic products}} |
|
{{NSAIDs}} |
|
|
{{Analgesics}} |
|
{{Analgesics}} |
|
|
|
|
|
] |
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
|
|
|
|
|
|
| Line 54: |
Line 62: |
|
{{analgesic-stub}} |
|
{{analgesic-stub}} |
|
{{heterocyclic-stub}} |
|
{{heterocyclic-stub}} |
|
|
|
|
] |
|
|
] |
|