Revision as of 19:49, 16 February 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,055 edits Saving copy of the {{chembox}} taken from revid 473604028 of page Acetaminosalol for the Chem/Drugbox validation project (updated: 'ChEBI', 'CASNo'). |
Latest revision as of 14:13, 6 February 2024 edit VastV0idInSpace0 (talk | contribs)Extended confirmed users2,431 edits Fixed spacing between stub templates and category templates.Tag: 2017 wikitext editor |
Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
|
{{chembox |
|
{{chembox |
|
| Verifiedfields = changed |
|
| Verifiedfields = changed |
|
|
| Watchedfields = changed |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
⚫ |
| verifiedrevid = 477238586 |
⚫ |
| UNII = O3J7H54KMD |
|
|
⚫ |
| ImageFile = Acetaminosalol.png |
⚫ |
| verifiedrevid = 456662081 |
|
⚫ |
| ImageFile = Acetaminosalol .png |
|
|
| ImageFile_Ref = {{chemboximage|correct|??}} |
|
| ImageFile_Ref = {{chemboximage|correct|??}} |
|
| ImageSize = 244 |
|
| ImageSize = 244 |
|
| ImageName = Kekulé, skeletal formula of acetaminosalol |
|
| ImageName = Kekulé, skeletal formula of acetaminosalol |
|
|
| PIN = 4-Acetamidophenyl 2-hydroxybenzoate |
|
| IUPACName = (4-Acetamidophenyl) 2-hydroxybenzoate<ref>{{Cite web|url = http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=1984|title = salophen - PubChem Public Chemical Database|work = The PubChem Project|location = USA|publisher = National Center for Biotechnology Information}}</ref> |
|
|
| Section1 = {{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
| CASNo_Ref = {{cascite|changed|??}} |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
⚫ |
| UNII = O3J7H54KMD |
|
| CASNo = <!-- blanked - oldvalue: 118-57-0 --> |
|
|
|
| CASNo_Ref = {{cascite|changed|??}} |
|
| PubChem = 1984 |
|
|
|
| CASNo = 118-57-0 |
|
| PubChem_Ref = {{Pubchemcite|correct|pubchem}} |
|
|
| ChemSpiderID = 1907 |
|
| PubChem = 1984 |
|
|
| ChemSpiderID = 1907 |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| EINECS = 204-261-3 |
|
|
| MeSHName = Salophen |
|
| EINECS = 204-261-3 |
|
| ChEMBL = 92590 |
|
| MeSHName = Salophen |
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
| ChEMBL = 92590 |
|
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
| ChEBI_Ref = {{ebicite|changed|EBI}} |
|
| ChEBI_Ref = {{ebicite|changed|EBI}} |
|
| ChEBI = <!-- blanked - oldvalue: 250620 --> |
|
| ChEBI = 250620 |
|
| SMILES = CC(=O)Nc1ccc(OC(=O)c2ccccc2O)cc1 |
|
| SMILES = CC(=O)Nc1ccc(OC(=O)c2ccccc2O)cc1 |
|
| SMILES1 = CC(=O)NC1=CC=C(OC(=O)C2=CC=CC=C2O)C=C1 |
|
| SMILES1 = CC(=O)NC1=CC=C(OC(=O)C2=CC=CC=C2O)C=C1 |
|
| StdInChI = 1S/C15H13NO4/c1-10(17)16-11-6-8-12(9-7-11)20-15(19)13-4-2-3-5-14(13)18/h2-9,18H,1H3,(H,16,17) |
|
| StdInChI = 1S/C15H13NO4/c1-10(17)16-11-6-8-12(9-7-11)20-15(19)13-4-2-3-5-14(13)18/h2-9,18H,1H3,(H,16,17) |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| InChI = 1/C15H13NO4/c1-10(17)16-11-6-8-12(9-7-11)20-15(19)13-4-2-3-5-14(13)18/h2-9,18H,1H3,(H,16,17) |
|
| InChI = 1/C15H13NO4/c1-10(17)16-11-6-8-12(9-7-11)20-15(19)13-4-2-3-5-14(13)18/h2-9,18H,1H3,(H,16,17) |
|
| StdInChIKey = TWIIVLKQFJBFPW-UHFFFAOYSA-N |
|
| StdInChIKey = TWIIVLKQFJBFPW-UHFFFAOYSA-N |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| InChIKey = TWIIVLKQFJBFPW-UHFFFAOYAL |
|
| InChIKey = TWIIVLKQFJBFPW-UHFFFAOYAL |
|
}} |
|
}} |
|
| Section2 = {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| C=15|N=1|H=13|O=4 |
|
| C=15 | N=1 | H=13 | O=4 |
|
| ExactMass = 271.084457909 g mol<sup>-1</sup> |
|
| Density = 1.327 g cm<sup>−3</sup> |
|
⚫ |
| LogP = 2.562 |
|
| Density = 1.327 g cm<sup>-3</sup> |
|
|
| LogP = 2.562 |
|
| pKa = 7.874 |
|
| pKa = 7.874 |
|
| pKb = 6.123 |
⚫ |
| pKb = 6.123 |
|
|
}} |
|
}} |
|
| Section3 = {{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| FlashPt = 241.9 °C |
|
| FlashPtC = 241.9 |
|
}} |
|
}} |
|
}} |
|
}} |
|
|
|
|
|
'''Acetaminosalol''' is an organic ] with the ] C<sub>15</sub>H<sub>13</sub>NO<sub>4</sub>. |
|
|
|
|
|
It is an esterification product of ] and ]. It was marketed by ] under the brand name '''Salophen''' as an analgesic in the late 19th and early 20th centuries. |
|
|
|
|
|
==Action and uses== |
|
|
|
|
|
In a warm alkaline solution acetaminosalol is broken up into salicylic acid and paracetamol. It is decomposed in the intestines, even when given as an injection. It was used as a substitute for salicylic acid in acute rheumatism, and as an intestinal antiseptic. It was similarly effective and much safer than ], another intestinal antiseptic commonly used at the time. The fact that it is tasteless renders it easy to administer. |
|
|
] |
|
|
{{clear-left}} |
|
|
|
|
|
==References== |
|
|
{{reflist}} |
|
|
|
|
|
|
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
|
|
|
|
|
|
{{analgesic-stub}} |
|
|
{{ester-stub}} |