| Revision as of 15:45, 16 February 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,055 edits Saving copy of the {{chembox}} taken from revid 453500551 of page 1-Butyl-3-methylimidazolium_hexafluorophosphate for the Chem/Drugbox validation project (updated: 'CASNo'). |
Latest revision as of 19:45, 14 December 2024 edit Smokefoot (talk | contribs)Autopatrolled, Extended confirmed users, Pending changes reviewers, Rollbackers74,950 edits Misplaced Pages is looking for reviews and textbook refs for such a mature area. MDPI is a predatory source |
| Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
|
{{chembox |
|
{{chembox |
|
|
| Verifiedfields = changed |
| ⚫ |
| verifiedrevid = 399189869 |
|
|
|
| Watchedfields = changed |
| ⚫ |
| ImageFile = bmim.svg |
|
|
⚫ |
| verifiedrevid = 477199310 |
| ⚫ |
|ImageSize= |
|
|
⚫ |
| ImageFile = ILfromOS.svg |
| ⚫ |
|IUPACName=1-butyl-3-methylimidazol-3-ium hexafluorophosphate |
|
|
⚫ |
| ImageSize = 220 |
| ⚫ |
|OtherNames= BMIM-PF<sub>6</sub> |
|
|
|
| ImageFile1 = BMIM-PF6-3D-balls.png |
|
|
| ImageSize1 = 220 |
|
|
| ImageAlt1 = BMIM cation and PF6 anion |
|
⚫ |
| IUPACName=1-butyl-3-methylimidazol-3-ium hexafluorophosphate |
|
⚫ |
| OtherNames= BMIM-PF<sub>6</sub> |
|
|Section1={{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 2015930 |
|
| ChemSpiderID = 2015930 |
|
| InChI = 1/C8H15N2.F6P/c1-3-4-5-10-7-6-9(2)8-10;1-7(2,3,4,5)6/h6-8H,3-5H2,1-2H3;/q+1;-1 |
|
| InChI = 1/C8H15N2.F6P/c1-3-4-5-10-7-6-9(2)8-10;1-7(2,3,4,5)6/h6-8H,3-5H2,1-2H3;/q+1;-1 |
| Line 16: |
Line 20: |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = IXQYBUDWDLYNMA-UHFFFAOYSA-N |
|
| StdInChIKey = IXQYBUDWDLYNMA-UHFFFAOYSA-N |
|
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
| CASNo = <!-- blanked - oldvalue: 174501-64-5 --> |
|
|
|
| CASNo= 174501-64-5 |
| ⚫ |
| PubChem=2734174 |
|
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
| ⚫ |
| SMILES= CCCCN1C=C(=C1)C.F(F)(F)(F)(F)F |
|
|
|
| UNII = ZGE3N4O8Q9 |
| ⚫ |
}} |
|
|
⚫ |
| PubChem=2734174 |
|
⚫ |
| SMILES= CCCCN1C=C(=C1)C.F(F)(F)(F)(F)F |
|
⚫ |
}} |
|
|Section2={{Chembox Properties |
|
|Section2={{Chembox Properties |
|
|
| C=8 | H=15 | F=6 | N=2 | P=1 |
|
| Formula=C<sub>8</sub>H<sub>15</sub>F<sub>6</sub>N<sub>2</sub>P |
|
|
⚫ |
| Appearance= Light yellow liquid |
|
| MolarMass=284.18228 |
|
|
⚫ |
| Density= 1.38 g/mL (20 °C) |
| ⚫ |
| Appearance= Light Yellow, Liquid |
|
|
|
| MeltingPtC= -8 |
| ⚫ |
| Density= 1.38 g/mL at 20 °C |
|
|
⚫ |
| Solubility=insoluble |
|
| MeltingPt= |
|
|
⚫ |
}} |
|
| BoilingPt= |
|
| ⚫ |
| Solubility= |
|
| ⚫ |
}} |
|
|
|Section3={{Chembox Hazards |
|
|
| MainHazards= |
|
|
| FlashPt= |
|
|
| Autoignition= |
|
|
}} |
|
|
}} |
|
}} |
|
|
|
|
|
'''1-Butyl-3-methylimidazolium ]''', also known as '''BMIM-PF<sub>6</sub>''', is a viscous, colourless, ] and non-water-soluble ] with a melting point<ref>{{cite book|url=https://books.google.com/books?id=y8d9F7NG60cC&pg=PR27|page=xxvii|title=Ionic Liquids in Chemical Analysis|author=Mihkel Koel|publisher=CRC Press|year=2008|isbn=978-1-4200-4646-5}}</ref> of -8 °C. Together with 1-butyl-3-methylimidazolium tetrafluoroborate, BMIM-BF<sub>4</sub>, it is one of the most widely studied ionic liquids. It is known to very slowly decompose in the presence of water.<ref>{{cite journal |author1=R.P. Swatloski |author2=J.D. Holbrey |author3=R.D. Rogers|name-list-style=amp | title = Ionic liquids are not always green: hydrolysis of 1-butyl-3-methylimidazolium hexafluorophosphate | journal = ]| year = 2003 | volume = 5 | pages = 361–363 | doi = 10.1039/b304400a | issue = 4}}</ref> |
|
|
|
|
|
==Preparation and uses== |
|
|
BMIM-PF<sub>6</sub> is commercially available. It may be obtained in two steps: BMIM-Cl is synthesized by alkylating ] with ]. A metathesis reaction with ] gives the desired compound; the tetrafluoroborate may be prepared by analogously using ].<ref>{{OrgSynth | vauthors = Dupont J, Consorti C, Suarez P, de Souza R | title = Preparation of 1-Butyl-3-methyl imidazolium-based Room Temperature Ionic Liquids | collvol = 10 | collvolpages = 184 | year = 2004 | prep = v79p0236}}</ref> |
|
|
|
|
|
:] |
|
|
|
|
|
|
|
|
BMIM-PF<sub>6</sub> has been investigated in electrochemistry where it serves both as solvent and electrolyte.<ref>{{Cite |author=Álvaro Pérez-Salado Kamps, Dirk Tuma, Jianzhong Xia, Gerd Maurer |title=Solubility of CO<sub>2</sub> in the Ionic Liquid |volume=48 |number=3 |date=2003 |DOI=10.1021/je034023f |pages=746–749}}</ref> and electrochemical CO<sub>2</sub> reduction.<ref>{{Cite |author=Yeonji Oh, Xile Hu |title=Ionic liquids enhance the electrochemical CO<sub>2</sub> reduction catalyzed by MoO<sub>2</sub> |volume=51 |number=71 |date=2015 |DOI=10.1039/C5CC05263G |pages=13698–13701}}</ref> |
|
|
|
|
|
==See also== |
|
|
* ] |
|
|
|
|
|
==References== |
|
|
{{reflist}} |
|
|
|
|
|
==Further reading== |
|
|
* {{cite journal |author1=S. Carda-Broch |author2=A. Berthod |author3=D.W. Armstrong | title = Solvent properties of the 1-butyl-3-methylimidazolium hexafluorophosphate ionic liquid | journal = ] | volume = 375 | issue = 2 | pages = 191–199 | doi = 10.1007/s00216-002-1684-1 | pmid = 12560962 | year = 2003|s2cid=32506513 }} |
|
|
|
|
|
{{Hexafluorophosphates}} |
|
|
|
|
|
{{DEFAULTSORT:Butyl-3-methylimidazolium hexafluorophosphate, 1-}} |
|
|
] |
|
|
] |
|
|
] |