| Revision as of 12:11, 8 August 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{drugbox}} (no changed fields - added verified revid - updated 'DrugBank_Ref', 'UNII_Ref', 'ChEMBL_Ref', 'ChEBI_Ref', 'KEGG_Ref', 'ChEBI_Ref') per Chem/Drugbox validation (report [[Wiki← Previous edit |
Latest revision as of 03:03, 26 September 2024 edit undoMdewman6 (talk | contribs)Extended confirmed users, Page movers, New page reviewers, Pending changes reviewers, Rollbackers21,833 edits remove redundant name |
| (35 intermediate revisions by 28 users not shown) |
| Line 1: |
Line 1: |
|
|
{{Short description|Opioid analgesic}} |
| ⚫ |
{{drugbox | verifiedrevid = 443667380 |
|
|
|
{{lowercasetitle}} |
|
| |
|
|
|
{{Drugbox |
| ⚫ |
| IUPAC_name = ''N''--''N''-phenylpropanamide |
|
|
|
| drug_name = β-Hydroxyfentanyl |
| ⚫ |
| image = Betahydroxyfentanyl.svg |
|
|
⚫ |
| verifiedrevid = 443668490 |
|
| width = 200px |
|
|
⚫ |
| IUPAC_name = ''N''--''N''-phenylpropanamide |
| ⚫ |
| CASNo_Ref = {{cascite|correct|??}} |
|
|
⚫ |
| image = Betahydroxyfentanyl.svg |
|
| InChI = 1/C22H28N2O2/c1-2-22(26)24(19-11-7-4-8-12-19)20-13-15-23(16-14-20)17-21(25)18-9-5-3-6-10-18/h3-12,20-21,25H,2,13-17H2,1H3 |
|
|
|
| width = 220px |
|
| InChIKey = JEFVHLMGRUJLET-UHFFFAOYAK |
|
|
⚫ |
| image2 = B-hydroxyfentanyl 3D BS.png |
|
|
| width2 = 220px |
|
|
|
|
|
<!--Clinical data--> |
|
|
| tradename = |
|
⚫ |
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
⚫ |
| pregnancy_US = <!-- A / B / C / D / X --> |
|
⚫ |
| pregnancy_category = |
|
⚫ |
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 --> |
|
|
| legal_BR = F1 |
|
⚫ |
| legal_CA = Schedule I |
|
⚫ |
| legal_UK = Class A |
|
⚫ |
| legal_US = Schedule I |
|
|
| legal_DE = Anlage I |
|
⚫ |
| routes_of_administration = |
|
|
<!--Pharmacokinetic data--> |
|
⚫ |
| bioavailability = |
|
⚫ |
| protein_bound = |
|
⚫ |
| metabolism = |
|
⚫ |
| elimination_half-life = |
|
⚫ |
| excretion = |
|
|
<!--Identifiers--> |
|
⚫ |
| CAS_number = 78995-10-5 |
|
⚫ |
| ATC_prefix = none |
|
⚫ |
| ATC_suffix = |
|
⚫ |
| PubChem = 62278 |
|
⚫ |
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
⚫ |
| DrugBank = DB01453 |
|
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
|
| KEGG = C22749 |
|
⚫ |
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII = 6Q4XAW26T4 |
|
⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
⚫ |
| ChemSpiderID = 56079 |
|
|
<!--Chemical data--> |
|
⚫ |
| C=22 | H=28 | N=2 | O=2 |
|
⚫ |
| smiles = O=C(N(c1ccccc1)C3CCN(CC(O)c2ccccc2)CC3)CC |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/C22H28N2O2/c1-2-22(26)24(19-11-7-4-8-12-19)20-13-15-23(16-14-20)17-21(25)18-9-5-3-6-10-18/h3-12,20-21,25H,2,13-17H2,1H3 |
|
| StdInChI = 1S/C22H28N2O2/c1-2-22(26)24(19-11-7-4-8-12-19)20-13-15-23(16-14-20)17-21(25)18-9-5-3-6-10-18/h3-12,20-21,25H,2,13-17H2,1H3 |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = JEFVHLMGRUJLET-UHFFFAOYSA-N |
|
| StdInChIKey = JEFVHLMGRUJLET-UHFFFAOYSA-N |
|
|
| synonyms = |
| ⚫ |
| CAS_number = 78995-10-5 |
|
| ⚫ |
| synonyms = β-hydroxyfentanyl |
|
| ⚫ |
| ATC_prefix = none |
|
| ⚫ |
| ATC_suffix = |
|
| ⚫ |
| PubChem = 62278 |
|
| ⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ⚫ |
| ChemSpiderID=56079 |
|
| ⚫ |
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| ⚫ |
| DrugBank = DB01453 |
|
| ⚫ |
| C = 22 | H = 28 | N = 2 | O = 2 |
|
|
| molecular_weight = 352.47 g/mol |
|
| ⚫ |
| smiles = O=C(N(c1ccccc1)C3CCN(CC(O)c2ccccc2)CC3)CC |
|
| ⚫ |
| bioavailability = |
|
| ⚫ |
| protein_bound = |
|
| ⚫ |
| metabolism = |
|
| ⚫ |
| elimination_half-life = |
|
| ⚫ |
| excretion = |
|
| ⚫ |
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
| ⚫ |
| pregnancy_US = <!-- A / B / C / D / X --> |
|
| ⚫ |
| pregnancy_category= |
|
| ⚫ |
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 --> |
|
| ⚫ |
| legal_CA = Schedule I |
|
| ⚫ |
| legal_UK = Class A |
|
| ⚫ |
| legal_US = Schedule I |
|
|
| legal_status = |
|
| ⚫ |
| routes_of_administration = |
|
|
}} |
|
}} |
|
|
|
|
|
'''β-hydroxyfentanyl''' is an ] ] that is an ] of ]. |
|
'''β-Hydroxyfentanyl''' is an ] ] that is an ] of ]. |
|
|
|
|
|
β-hydroxyfentanyl was sold briefly on the black market in the early 1980s, before the introduction of the ] which for the first time attempted to control entire families of drugs based on their structural similarity rather than scheduling each drug individually as they appeared. <ref> Henderson GL. Designer Drugs: Past History and Future Prospects. Journal of Forensic Sciences 1988; 33(2):569-575 </ref> |
|
β-Hydroxyfentanyl was sold briefly on the black market in the early 1980s, before the introduction of the ] which for the first time attempted to control entire families of drugs based on their structural similarity rather than scheduling each drug individually as they appeared.<ref>{{cite journal | vauthors = Henderson GL | title = Designer drugs: past history and future prospects | journal = Journal of Forensic Sciences | volume = 33 | issue = 2 | pages = 569–75 | date = March 1988 | doi = 10.1520/JFS11976J | pmid = 3286815 }}</ref> |
|
|
|
|
|
|
] |
|
β-hydroxyfentanyl has similar effects to fentanyl. Side effects of fentanyl analogues are similar to those of fentanyl itself, which include ], ], and ], which can be serious and even life-threatening. |
|
|
|
|
|
|
Side effects of ] analogs are similar to those of fentanyl itself, which include ], ] and potentially serious ], which can be life-threatening. ] have killed hundreds of people throughout Europe and the former Soviet republics since the most recent resurgence in use began in Estonia in the early 2000s, and novel derivatives continue to appear.<ref>{{cite journal | vauthors = Mounteney J, Giraudon I, Denissov G, Griffiths P | title = Fentanyls: Are we missing the signs? Highly potent and on the rise in Europe | journal = The International Journal on Drug Policy | volume = 26 | issue = 7 | pages = 626–31 | date = July 2015 | pmid = 25976511 | doi = 10.1016/j.drugpo.2015.04.003 | url = http://www.ijdp.org/article/S0955-3959%2815%2900097-3/abstract }}</ref> |
|
|
|
|
|
== References == |
|
== References == |
|
|
{{Reflist|1}} |
|
<references /> |
|
|
|
|
|
|
{{Opioidergics}} |
|
|
|
|
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
|
] |
|
|
|
|
{{analgesic-stub}} |
|
|
|
|
|
] |
|
|
] |
|