Revision as of 19:59, 16 February 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,055 edits Saving copy of the {{chembox}} taken from revid 457803667 of page Acibenzolar-S-methyl for the Chem/Drugbox validation project (updated: 'ChEBI', 'CASNo').← Previous edit |
Revision as of 19:59, 16 February 2012 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,055 edits Saving copy of the {{drugbox}} taken from revid 473541861 of page Aciclovir for the Chem/Drugbox validation project (updated: 'DrugBank').Next edit → |
Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{Chembox |
|
{{Drugbox |
|
| Verifiedfields = changed |
|
| Verifiedfields = changed |
|
|
| Watchedfields = changed |
|
| verifiedrevid = 457802477 |
|
| verifiedrevid = 457802576 |
|
| Name = Acibenzolar-''S''-methyl |
|
|
|
| IUPAC_name = 2-Amino-1,9-dihydro-9-((2-hydroxyethoxy)methyl)-6''H''-Purin-6-one |
|
| Reference = <ref name="EPA"></ref> |
|
|
|
| image = Aciclovir standard.svg |
|
| ImageFile = acibenzolar-S-methyl.png |
|
|
|
| image2 = Acyclovir 3D.png |
⚫ |
| ImageFile_Ref = {{chemboximage|correct|??}} |
|
|
|
|
|
| ImageSize = 121 |
|
|
|
<!--Clinical data--> |
|
| ImageName = Skeletal formula of acibenzolar-S-methyl |
|
|
|
| tradename = |
|
| IUPACName = ''S''-Methyl 1,2,3-benzothiadiazole-7-carbothioate{{Citation needed|date = July 2011}} |
|
|
|
| Drugs.com = {{drugs.com|monograph|acyclovir}} |
|
| SystematicName = 1,2,3-Benzothiadiazol-7-yl(methylsulfanyl)methanone{{Citation needed|date = July 2011}} |
|
|
|
| MedlinePlus = a681045 |
|
| Section1 = {{Chembox Identifiers |
|
|
|
| pregnancy_category = B3 <small>(])</small>, B <small>(U.S.)</small> |
⚫ |
| CASNo_Ref = {{cascite|changed|??}} |
|
|
|
| legal_US = Rx-only |
|
| CASNo = <!-- blanked - oldvalue: 135158-54-2 --> |
|
|
|
| legal_status = unscheduled/S4 <small>(Au)</small>, POM <small>(UK)</small> |
⚫ |
| PubChem = 86412 |
|
|
|
| routes_of_administration = ], oral, topical |
|
| PubChem_Ref = {{Pubchemcite|correct|pubchem}} |
|
|
|
|
⚫ |
| ChemSpiderID = 77928 |
|
|
|
<!--Pharmacokinetic data--> |
⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
|
|
| bioavailability = 10–20% (oral) |
|
| EINECS = 420-050-0 |
|
|
|
| protein_bound = 9–33% |
|
| MeSHName = S-methyl+benzo(1,2,3)thiadiazole-7-carbothioate |
|
|
|
| metabolism = Viral thymidine kinase |
⚫ |
| ChEMBL = 425055 |
|
|
|
| elimination_half-life = 2.2–20 hours |
⚫ |
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
|
|
| excretion = ] |
⚫ |
| ChEBI_Ref = {{ebicite|changed|EBI}} |
|
|
|
|
|
| ChEBI = <!-- blanked - oldvalue: 447123 --> |
|
|
|
<!--Identifiers--> |
|
| SMILES = CSC(=O)c1cccc2nnsc12 |
|
|
⚫ |
| CASNo_Ref = {{cascite|correct|CAS}} |
|
| SMILES1 = CSC(=O)C1=C2SN=NC2=CC=C1 |
|
|
⚫ |
| CAS_number_Ref = {{cascite|correct|??}} |
|
| StdInChI = 1S/C8H6N2OS2/c1-12-8(11)5-3-2-4-6-7(5)13-10-9-6/h2-4H,1H3 |
|
|
|
| CAS_number = 59277-89-3 |
⚫ |
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
|
|
| ATC_prefix = J05 |
|
| InChI = 1/C8H6N2OS2/c1-12-8(11)5-3-2-4-6-7(5)13-10-9-6/h2-4H,1H3 |
|
|
|
| ATC_suffix = AB01 |
⚫ |
| StdInChIKey = UELITFHSCLAHKR-UHFFFAOYSA-N |
|
|
|
| ATC_supplemental = {{ATC|D06|BB03}} {{ATC|S01|AD03}} |
⚫ |
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
|
⚫ |
| PubChem = 2022 |
|
| InChIKey = UELITFHSCLAHKR-UHFFFAOYAA |
|
|
|
| DrugBank_Ref = {{drugbankcite|changed|drugbank}} |
|
}} |
|
|
|
| DrugBank = DB00787 |
|
| Section2 = {{Chembox Properties |
|
|
⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
⚫ |
| C=8|N=2|H=6|S=2|O=1 |
|
|
⚫ |
| ChemSpiderID = 1945 |
|
| ExactMass = 209.992154204 g mol<sup>-1</sup> |
|
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| Appearance = Pale, light orange, opaque crystals |
|
|
|
| UNII = X4HES1O11F |
|
| MeltingPtC = 133 |
|
|
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| Solubility = 7.7 mg dm<sup>-3</sup> |
|
|
| LogP = 2.741 |
|
| KEGG = D00222 |
|
⚫ |
| ChEBI_Ref = {{ebicite|correct|EBI}} |
|
}} |
|
|
|
| ChEBI = 2453 |
|
⚫ |
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
⚫ |
| ChEMBL = 184 |
|
|
|
|
|
<!--Chemical data--> |
|
⚫ |
| C=8 | H=11 | N=5 | O=3 |
|
|
| molecular_weight = 225.21 g/mol |
|
|
| smiles = O=C2/N=C(\Nc1n(cnc12)COCCO)N |
|
|
| InChI = 1/C8H11N5O3/c9-8-11-6-5(7(15)12-8)10-3-13(6)4-16-2-1-14/h3,14H,1-2,4H2,(H3,9,11,12,15) |
|
|
| InChIKey = MKUXAQIIEYXACX-UHFFFAOYAG |
|
⚫ |
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
|
| StdInChI = 1S/C8H11N5O3/c9-8-11-6-5(7(15)12-8)10-3-13(6)4-16-2-1-14/h3,14H,1-2,4H2,(H3,9,11,12,15) |
|
⚫ |
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
⚫ |
| StdInChIKey = MKUXAQIIEYXACX-UHFFFAOYSA-N |
|
|
| synonyms = acycloguanosine |
|
|
| melting_point = 256.5 |
|
}} |
|
}} |