Revision as of 15:36, 16 February 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,055 edits Saving copy of the {{chembox}} taken from revid 443314178 of page 2-Aminomuconic_semialdehyde for the Chem/Drugbox validation project (updated: 'CASNo').← Previous edit |
Revision as of 15:36, 16 February 2012 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,055 edits Saving copy of the {{chembox}} taken from revid 456508896 of page 2-Aminoisobutyric_acid for the Chem/Drugbox validation project (updated: 'DrugBank').Next edit → |
Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{chembox |
|
{{chembox |
|
|
| Verifiedfields = changed |
|
| verifiedrevid = 443313218 |
|
| verifiedrevid = 456507634 |
|
| ImageFile = 2-aminomuconic semialdehyde.png |
|
|
|
| Name = 2-Aminoisobutyric acid |
|
| ImageName = Skeletal formula |
|
|
|
| ImageFile = 2-aminoisobutyric acid.svg |
|
| ImageFile1 = 2-Aminomuconic-semialdehyde-3D-balls.png |
|
|
⚫ |
| IUPACName = 2-Amino-2-methylpropanoic acid |
|
| ImageName1 = Ball-and-stick model |
|
|
|
| OtherNames = α-Aminoisobutyric acid<br/>2-Methylalanine |
⚫ |
|IUPACName=2-Amino-6-oxohexa-2,4-dienoic acid |
|
|
⚫ |
| Section1 = {{Chembox Identifiers |
|
|OtherNames= |
|
|
⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
⚫ |
|Section1={{Chembox Identifiers |
|
|
⚫ |
| ChemSpiderID = 5891 |
⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
|
⚫ |
| KEGG_Ref = {{keggcite|correct|kegg}} |
⚫ |
| ChemSpiderID = 4444230 |
|
|
|
| KEGG = C03665 |
|
| InChI = 1/C6H7NO3/c7-5(6(9)10)3-1-2-4-8/h1-4H,7H2,(H,9,10)/b2-1-,5-3+ |
|
|
|
| InChI = 1/C4H9NO2/c1-4(2,5)3(6)7/h5H2,1-2H3,(H,6,7) |
|
| InChIKey = QCGTZPZKJPTAEP-REDYYMJGBN |
|
|
|
| ChEBI_Ref = {{ebicite|correct|EBI}} |
⚫ |
| SMILES1 = O=C\C=C\C=C(/N)C(=O)O |
|
|
|
| ChEBI = 27971 |
|
⚫ |
| SMILES = O=C(O)C(N)(C)C |
|
|
| InChIKey = FUOOLUPWFVMBKG-UHFFFAOYAD |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/C6H7NO3/c7-5(6(9)10)3-1-2-4-8/h1-4H,7H2,(H,9,10)/b2-1-,5-3+ |
|
| StdInChI = 1S/C4H9NO2/c1-4(2,5)3(6)7/h5H2,1-2H3,(H,6,7) |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = QCGTZPZKJPTAEP-REDYYMJGSA-N |
|
| StdInChIKey = FUOOLUPWFVMBKG-UHFFFAOYSA-N |
|
| CASNo = <!-- blanked - oldvalue: 150994-59-5 --> |
|
| CASNo = 62-57-7 |
|
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
| PubChem=30 |
|
|
|
| EC-number = 200-544-0 |
⚫ |
| ChEBI_Ref = {{ebicite|correct|EBI}} |
|
|
| ChEBI = 15745 |
|
| PubChem = 6119 |
|
|
| DrugBank_Ref = {{drugbankcite|changed|drugbank}} |
|
| SMILES=C(=CC=O)C=C(C(=O)O)N |
|
|
|
| DrugBank = DB02952 |
|
}} |
|
}} |
|
|Section2={{Chembox Properties |
|
| Section2 = {{Chembox Properties |
|
| Formula=C<sub>6</sub>H<sub>7</sub>NO<sub>3</sub> |
|
|
|
| C=4 | H=9 | N=1 | O=2 |
|
| MolarMass=141.12 g/mol |
|
| MolarMass = 103.12 g/mol |
|
| Appearance= |
|
|
|
| pKa=2.36 (carboxyl), 10.21 (amino)<ref>Dawson, R.M.C., et al., ''Data for Biochemical Research'', Oxford, Clarendon Press, 1959.</ref> |
|
| Density= |
|
|
| MeltingPt= |
|
|
| BoilingPt= |
|
|
| Solubility= |
|
|
}} |
|
|
|Section3={{Chembox Hazards |
|
|
| MainHazards= |
|
|
| FlashPt= |
|
|
| Autoignition= |
|
|
}} |
|
}} |
|
}} |
|
}} |