Revision as of 10:46, 20 February 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,055 edits Saving copy of the {{chembox}} taken from revid 442174255 of page Thioflavin for the Chem/Drugbox validation project (updated: 'CASNo').← Previous edit |
Revision as of 10:47, 20 February 2012 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,055 edits Saving copy of the {{chembox}} taken from revid 473552464 of page Thioproperazine for the Chem/Drugbox validation project (updated: 'DrugBank', 'ChEBI').Next edit → |
Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{chembox |
|
{{chembox |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
⚫ |
| verifiedrevid = 442173219 |
|
|
| Name = Thioflavin T |
|
| UNII = YJ050AQ56X |
|
⚫ |
| verifiedrevid = 452423912 |
|
| ImageFile = Thioflavin T.png |
|
|ImageFile=Thioproperazine.png |
|
| ImageSize = |
|
|ImageSize=200px |
|
| ImageFile1 = Thioflavin-T-3D-balls.png |
|
|
|
|IUPACName=N,N-dimethyl-10-phenothiazine-2-sulfonamide |
|
| ImageSize1 = 200px |
|
|
⚫ |
|OtherNames= |
|
| IUPACName = <span style="white-space:nowrap;">4-(3,6-dimethyl-1,3-benzothiazol-3<br />-ium-2-yl)-N,N-dimethylaniline chloride</span> |
|
|
⚫ |
|Section1={{Chembox Identifiers |
⚫ |
| OtherNames = |
|
|
|
| CASNo_Ref = {{cascite|correct|CAS}} |
⚫ |
| Section1 = {{Chembox Identifiers |
|
|
|
| CASNo=316-81-4 |
⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
|
| ChemSpiderID = 16062 |
|
| DrugBank = DB01622 |
|
|
| ChEBI = 59120 |
|
⚫ |
| PubChem=9429 |
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
| ChEMBL = 224392 |
|
| ChEMBL = 609109 |
|
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| ChEMBL2 = 224392 |
|
|
|
| KEGG = D08585 |
|
| InChI = 1/C17H19N2S.ClH/c1-12-5-10-15-16(11-12)20-17(19(15)4)13-6-8-14(9-7-13)18(2)3;/h5-11H,1-4H3;1H/q+1;/p-1 |
|
|
|
| SMILES=CN1CCN(CC1)CCCN2C3=CC=CC=C3SC4=C2C=C(C=C4)S(=O)(=O)N(C)C |
|
| InChIKey = JADVWWSKYZXRGX-REWHXWOFAC |
|
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
|
| ChemSpiderID = 9058 |
|
| StdInChI = 1S/C17H19N2S.ClH/c1-12-5-10-15-16(11-12)20-17(19(15)4)13-6-8-14(9-7-13)18(2)3;/h5-11H,1-4H3;1H/q+1;/p-1 |
|
|
|
| InChI = 1/C22H30N4O2S2/c1-23(2)30(27,28)18-9-10-22-20(17-18)26(19-7-4-5-8-21(19)29-22)12-6-11-25-15-13-24(3)14-16-25/h4-5,7-10,17H,6,11-16H2,1-3H3 |
⚫ |
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
|
|
| InChIKey = VZYCZNZBPPHOFY-UHFFFAOYAJ |
⚫ |
| StdInChIKey = JADVWWSKYZXRGX-UHFFFAOYSA-M |
|
|
⚫ |
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| CASNo = <!-- blanked - oldvalue: 2390-54-7 --> |
|
|
|
| StdInChI = 1S/C22H30N4O2S2/c1-23(2)30(27,28)18-9-10-22-20(17-18)26(19-7-4-5-8-21(19)29-22)12-6-11-25-15-13-24(3)14-16-25/h4-5,7-10,17H,6,11-16H2,1-3H3 |
⚫ |
| PubChem = 16953 |
|
|
⚫ |
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| SMILES = .s2c1cc(ccc1(c2c3ccc(N(C)C)cc3)C)C |
|
|
⚫ |
| StdInChIKey = VZYCZNZBPPHOFY-UHFFFAOYSA-N |
⚫ |
}} |
|
|
| Section2 = {{Chembox Properties |
|
⚫ |
| Formula = C<sub>17</sub>H<sub>19</sub>ClN<sub>2</sub>S |
|
⚫ |
| MolarMass = 318.86 g/mol |
|
|
| Appearance = |
|
⚫ |
| Density = |
|
⚫ |
| MeltingPt = |
|
⚫ |
| BoilingPt = |
|
⚫ |
| Solubility = |
|
|
}} |
|
}} |
|
| Section3 = {{Chembox Hazards |
|
|Section2={{Chembox Properties |
|
⚫ |
| Formula=C<sub>22</sub>H<sub>30</sub>N<sub>4</sub>O<sub>2</sub>S<sub>2</sub> |
⚫ |
| MainHazards = |
|
|
⚫ |
| MolarMass=446.6292 |
⚫ |
| FlashPt = |
|
|
| Autoignition = |
|
| Appearance= |
|
⚫ |
| Density= |
|
⚫ |
| MeltingPt= |
|
⚫ |
| BoilingPt= |
|
⚫ |
| Solubility= |
|
⚫ |
}} |
|
|
|Section3={{Chembox Hazards |
|
⚫ |
| MainHazards= |
|
⚫ |
| FlashPt= |
|
|
| Autoignition= |
|
}} |
|
}} |
|
}} |
|
}} |