Revision as of 15:35, 16 February 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,055 edits Saving copy of the {{chembox}} taken from revid 452190457 of page 2-C-Methylerythritol_4-phosphate for the Chem/Drugbox validation project (updated: 'CASNo').← Previous edit |
Revision as of 15:36, 16 February 2012 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,055 edits Saving copy of the {{chembox}} taken from revid 452997683 of page 2-Arachidonyl_glyceryl_ether for the Chem/Drugbox validation project (updated: 'CASNo').Next edit → |
Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{chembox |
|
{{chembox |
|
| verifiedrevid = 446635897 |
|
| verifiedrevid = 413108402 |
|
⚫ |
| ImageFile = 2-AGE.png |
|
|Name=2-''C''-Methylerythritol 4-phosphate |
|
|
⚫ |
| ImageSize = 250px |
⚫ |
|ImageFile=MEP.png |
|
|
|
| IUPACName = 2--1,3-propanediol |
⚫ |
|ImageSize= |
|
|
|
| OtherNames = 2-AGE, 2-arachidonylglyceryl ether, Noladin ether, Noladin |
|
|IUPACName=2,3,4-trihydroxy-3-methylbutyl dihydrogen phosphate |
|
|
⚫ |
| Section1 = {{Chembox Identifiers |
|
|OtherNames=2-''C''-Methyl-<small>D</small>-erythritol 4-phosphate |
|
|
|
| InChI = 1/C23H40O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-26-23(21-24)22-25/h6-7,9-10,12-13,15-16,23-25H,2-5,8,11,14,17-22H2,1H3/b7-6-,10-9-,13-12-,16-15- |
⚫ |
|Section1= {{Chembox Identifiers |
|
|
|
| InChIKey = CUJUUWXZAQHCNC-DOFZRALJBH |
|
| Abbreviations = MEP |
|
|
⚫ |
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
⚫ |
| CASNo = <!-- blanked - oldvalue: 206440-72-4 --> |
|
|
|
| ChEMBL = 146346 |
⚫ |
| PubChem=443198 |
|
⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
⚫ |
| ChemSpiderID = 10246067 |
|
⚫ |
| ChEBI_Ref = {{ebicite|correct|EBI}} |
|
|
| ChEBI = 58262 |
|
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/C5H13O7P/c1-5(8,3-6)4(7)2-12-13(9,10)11/h4,6-8H,2-3H2,1H3,(H2,9,10,11)/p-2/t4-,5+/m1/s1 |
|
| StdInChI = 1S/C23H40O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-26-23(21-24)22-25/h6-7,9-10,12-13,15-16,23-25H,2-5,8,11,14,17-22H2,1H3/b7-6-,10-9-,13-12-,16-15- |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = XMWHRVNVKDKBRG-UHNVWZDZSA-L |
|
| StdInChIKey = CUJUUWXZAQHCNC-DOFZRALJSA-N |
|
⚫ |
| CASNo = <!-- blanked - oldvalue: 222723-55-9 --> |
|
| SMILES=CC(CO)(C(COP(=O)(O)O)O)O |
|
|
⚫ |
| PubChem = 6483057 |
|
|
| SMILES = OCC(OCCCC\C=C/C/C=C\C\C=C/C\C=C/CCCCC)CO |
|
|
| MeSHName = |
|
⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
⚫ |
| ChemSpiderID = 4983515 |
|
}} |
|
}} |
|
|Section2= {{Chembox Properties |
|
| Section2 = {{Chembox Properties |
|
| Formula=C<sub>5</sub>H<sub>13</sub>O<sub>7</sub>P |
|
| Formula = C<sub>23</sub>H<sub>40</sub>O<sub>3</sub> |
|
| MolarMass=216.126 |
|
| MolarMass = 364.56 g/mol |
|
| Appearance= |
|
| Appearance = |
|
| Density= |
|
| Density = |
|
| MeltingPt= |
|
| MeltingPt = |
|
| BoilingPt= |
|
| BoilingPt = |
|
| Solubility= |
|
|
}} |
|
}} |
|
|Section3= {{Chembox Hazards |
|
| Section3 = {{Chembox Hazards |
|
| MainHazards= |
|
| Solubility = |
|
| FlashPt= |
|
| MainHazards = |
|
| Autoignition= |
|
| FlashPt = |
|
|
| Autoignition = |
|
}} |
|
}} |
|
}} |
|
}} |