Misplaced Pages:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox: Difference between revisions

< Misplaced Pages:WikiProject Chemicals | Chembox validation Browse history interactively ← Previous edit Next edit →Content deleted Content addedVisual WikitextInline

Revision as of 13:32, 15 February 2012 editBeetstra (talk \| contribs)Edit filter managers, Administrators172,055 edits Saving copy of the {{chembox}} taken from revid 472531943 of page Cadmium_telluride for the Chem/Drugbox validation project (updated: '').← Previous edit		Revision as of 13:32, 15 February 2012 edit undoBeetstra (talk \| contribs)Edit filter managers, Administrators172,055 edits Saving copy of the {{chembox}} taken from revid 476453549 of page Chromium_trioxide for the Chem/Drugbox validation project (updated: '').Next edit →
Line 1:		Line 1:
	{{ambox \| text = This page contains a copy of the infobox ({{tl\|chembox}}) taken from revid of page ] with values updated to verified values.}}		{{ambox \| text = This page contains a copy of the infobox ({{tl\|chembox}}) taken from revid of page ] with values updated to verified values.}}
	{{~~chembox~~		{{Chembox
	\| Watchedfields = changed		\| Watchedfields = changed
	\| verifiedrevid = ~~451684982~~		\| verifiedrevid = 451421780
			\| ImageFile = Chrom(VI)-oxid.jpg
	\| Name = Cadmium telluride
	\| ~~ImageFile~~ = ~~CdTe.jpg~~		\| ImageSize = 244
			\| ImageFile1 = CrO3-from-xtal-1970-bulk-3D-balls.png
	\| ImageName = Cadmium telluride
			\| IUPACName = Chromium trioxide<br />Chromium(VI) oxide
	\| OtherNames = Irtran-6
			\| OtherNames = Chromic anhydride, chromium(VI) oxide, chromic acid, anhydride, chromic acid (misnomer)
	\| Section1 = {{Chembox Identifiers		\| Section1 = {{Chembox Identifiers
	\| ChemSpiderID_Ref = {{chemspidercite\|correct\|chemspider}}		\| ChemSpiderID_Ref = {{chemspidercite\|correct\|chemspider}}
	\| ChemSpiderID = ~~82622~~		\| ChemSpiderID = 14212
			\| UNII_Ref = {{fdacite\|correct\|FDA}}
⚫	\| InChI = 1/Cd.Te/~~rCdTe~~/c1-2
	\| ~~SMILES~~ = =		\| UNII = 8LV49809UC
		⚫	\| InChI = 1/Cr.3O/rCrO3/c2-1(3)4
	\| InChIKey = RPPBZEBXAAZZJH-UEZHWRJLAD
			\| ChEBI_Ref = {{ebicite\|correct\|EBI}}
			\| ChEBI = 48240
			\| SMILES = O=(=O)=O
			\| InChIKey = WGLPBDUCMAPZCE-YFSAMUSXAF
	\| StdInChI_Ref = {{stdinchicite\|correct\|chemspider}}		\| StdInChI_Ref = {{stdinchicite\|correct\|chemspider}}
	\| StdInChI = 1S/Cd.Te		\| StdInChI = 1S/Cr.3O
	\| StdInChIKey_Ref = {{stdinchicite\|correct\|chemspider}}		\| StdInChIKey_Ref = {{stdinchicite\|correct\|chemspider}}
	\| StdInChIKey = ~~RPPBZEBXAAZZJH~~-UHFFFAOYSA-N		\| StdInChIKey = WGLPBDUCMAPZCE-UHFFFAOYSA-N
	\| CASNo = ~~1306~~-25-8		\| CASNo = 1333-82-0
	\| CASNo_Ref = {{cascite\|correct\|CAS}}		\| CASNo_Ref = {{cascite\|correct\|CAS}}
	\| PubChem = ~~91501~~		\| PubChem = 14915
	\| RTECS = ~~EV3330000~~		\| RTECS = GB6650000
			\| UNNumber = 1463
	}}		}}
	\| Section2 = {{Chembox Properties		\| Section2 = {{Chembox Properties
	\| ~~Cd=1 \| Te~~ = 1		\| Cr = 1
			\| O = 3
	\| MolarMass = 240.01 g/mol
			\| ExactMass = 99.9925256
⚫	\| Density = 6.2 g/cm<sup>3</sup>
			\| Appearance = dark red granular solid <br> ]
	\| Solublity = insoluble
			\| Odor = odorless
	\| Solvent = other solvents
		⚫	\| Density = 2.70 g/cm<sup>3</sup> (20 °C)
	\| SolubleOther = insoluble
	\| ~~MeltingPt~~ = ~~1092 °C~~		\| MeltingPtC = 197
	\| ~~BoilingPt~~ = ~~1130 °C~~		\| BoilingPtC = 251
			\| Boiling_notes = decomposes
	\| BandGap = 1.44 eV (@300 K, direct)
			\| Solubility = 61.7 g/100 mL (0 °C) <br /> 63 g/100 mL (25 °C) <br /> 67.45 g/100 mL (100 °C)
	\| RefractIndex = 2.67 (@10 µm)
			\| SolubleOther = soluble in ], ], ], ], ], ]
	}}		}}
	\| ~~Section3~~ = {{Chembox ~~Structure~~		\| Section4 = {{Chembox Hazards
	\| CrystalStruct = ] (] F-43m
			\| ExternalMSDS =
⚫	}}
		⚫	\| EUIndex = 024-001-00-0
	\| Section7 = {{Chembox Hazards
			\| EUClass = Oxidizer ('''O''')<br />]<br />]<br />Repr. Cat. 3<br />Very toxic ('''T+''')<br />Dangerous for the environment ('''N''')
	\| ExternalMSDS =
			\| RPhrases = {{R45}}, {{R46}}, {{R9}}, {{R24/25}}, {{R26}}, {{R35}}, {{R42/43}}, {{R48/23}}, {{R62}}, {{R50/53}}
	\| EUClass = Harmful ('''Xn''')<br/>Dangerous for the environment ('''N''')
		⚫	\| SPhrases = {{S53}}, {{S45}}, {{S60}}, {{S61}}
⚫	\| EUIndex = ~~048~~-001-00-5
			\| NFPA-H = 3
	\| RPhrases = {{R20/21/22}}, {{R50/53}}
			\| NFPA-F = 1
⚫	\| SPhrases = {{S2}}, {{S60}}, {{S61}}
			\| NFPA-R = 1
⚫	}}
			\| NFPA-O = OX
	\| Section8 = {{Chembox Related
			\| LD50 = 80 mg/kg
	\| OtherAnions = ]<br/>]<br/>]
		⚫	}}
	\| OtherCations = ]<br/>]
			\| Section5 = {{Chembox Thermochemistry
	}}
			\| DeltaHf = −579 kJ·mol<sup>−1</sup>
			\| Entropy = 72 J·mol<sup>−1</sup>·K<sup>−1</sup>
		⚫	}}
	}}		}}

Revision as of 13:32, 15 February 2012

This page contains a copy of the infobox ({{chembox}}) taken from revid 476453549 of page Chromium_trioxide with values updated to verified values.

WikiProject Chemicals/Chembox validation/VerifiedDataSandbox
Names


IUPAC names Chromium trioxide Chromium(VI) oxide
Other names Chromic anhydride, chromium(VI) oxide, chromic acid, anhydride, chromic acid (misnomer)
Identifiers
CAS Number	1333-82-0
3D model (JSmol)	Interactive image
ChEBI	CHEBI:48240
ChemSpider	14212
PubChem CID	14915
RTECS number	GB6650000
UNII	8LV49809UC
UN number	1463
InChI InChI=1S/Cr.3OKey: WGLPBDUCMAPZCE-UHFFFAOYSA-N InChI=1/Cr.3O/rCrO3/c2-1(3)4Key: WGLPBDUCMAPZCE-YFSAMUSXAF
SMILES O=(=O)=O
Properties
Chemical formula	CrO₃
Molar mass	99.993 g·mol
Appearance	dark red granular solid deliquescent
Odor	odorless
Density	2.70 g/cm (20 °C)
Melting point	197 °C (387 °F; 470 K)
Boiling point	251 °C (484 °F; 524 K)
Solubility in water	61.7 g/100 mL (0 °C) 63 g/100 mL (25 °C) 67.45 g/100 mL (100 °C)
Solubility	soluble in sulfuric acid, nitric acid, ethyl alcohol, ethyl ether, acetic acid, acetone
Hazards
NFPA 704 (fire diamond)	3 1 1 OX
Lethal dose or concentration (LD, LC):
LD₅₀ (median dose)	80 mg/kg
Thermochemistry
Std molar entropy (S₂₉₈)	72 J·mol·K
Std enthalpy of formation (Δ_fH₂₉₈)	−579 kJ·mol
Except where otherwise noted, data are given for materials in their standard state (at 25 °C , 100 kPa). Y verify (what is ?) Infobox references

Tracking categories (test):

SizeSet

Chemical compound