Revision as of 13:20, 10 January 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,055 edits Saving copy of the {{drugbox}} taken from revid 468444172 of page Thioridazine for the Chem/Drugbox validation project (updated: '').← Previous edit |
Revision as of 13:20, 10 January 2012 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,055 edits Saving copy of the {{drugbox}} taken from revid 451488931 of page Thiorphan for the Chem/Drugbox validation project (updated: 'DrugBank', 'CAS_number').Next edit → |
Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
|
{{Drugbox |
|
{{drugbox | Verifiedfields = changed |
|
|
|
| IUPAC_name = (±)-2-acetic acid |
|
| Watchedfields = changed |
|
|
|
| image = Thiorphan.png |
|
| verifiedrevid = 416502199 |
|
|
|
| width = 200px |
|
| IUPAC_name = 10-{2-ethyl}-<BR>2-methylsulfanylphenothiazine |
|
|
|
| imagename = 1 : 1 mixture (racemate) |
|
| image = Thioridazine-2D-skeletal.png |
|
|
| width = 175 |
|
| drug_name = Thiorphan |
|
| image2 = Thioridazine3d.png |
|
|
|
|
|
|
<!--Clinical data--> |
|
<!--Clinical data--> |
|
|
| tradename = |
|
| Drugs.com = {{drugs.com|CDI|thioridazine}} |
|
|
⚫ |
| pregnancy_category = |
|
| MedlinePlus = a682119 |
|
|
|
| legal_status = |
⚫ |
| pregnancy_category = Only if clearly needed |
|
|
|
| routes_of_administration = |
|
| legal_status = RX-only-medication, non-narcotic |
|
|
| routes_of_administration = oral (tablets, concentration, sometimes syrup) |
|
|
|
|
|
|
<!--Pharmacokinetic data--> |
|
<!--Pharmacokinetic data--> |
|
| bioavailability = incomplete |
|
| bioavailability = |
|
|
| protein_bound = |
|
| metabolism = hepatic |
|
| metabolism = |
|
| elimination_half-life = 7–13 hours (up to 20 hours) |
|
| elimination_half-life = |
|
| excretion = feces |
|
| excretion = |
|
|
|
|
|
<!--Identifiers--> |
|
<!--Identifiers--> |
|
|
| CAS_number = <!-- blanked - oldvalue: 76721-89-6 --> |
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
|
⚫ |
| ATC_prefix = |
|
| CAS_number_Ref = {{cascite|correct|??}} |
|
|
| CAS_number = 50-52-2 |
|
| ATC_suffix = |
|
|
| StdInChI = 1S/C12H15NO3S/c14-11(15)7-13-12(16)10(8-17)6-9-4-2-1-3-5-9/h1-5,10,17H,6-8H2,(H,13,16)(H,14,15) |
⚫ |
| ATC_prefix = N05 |
|
|
⚫ |
| StdInChIKey = LJJKNPQAGWVLDQ-UHFFFAOYSA-N |
|
| ATC_suffix = AC02 |
|
|
| PubChem = 5452 |
|
| PubChem = 3132 |
|
|
| DrugBank = <!-- blanked - oldvalue: 3132 --> |
|
| IUPHAR_ligand = 100 |
|
|
⚫ |
| ChemSpiderID = 3020 |
|
| DrugBank_Ref = {{drugbankcite|changed|drugbank}} |
|
|
| DrugBank = DB00679 |
|
| ChEMBL = 10247 |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
⚫ |
| ChemSpiderID = 5253 |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII = N3D6TG58NI |
|
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
|
| KEGG = D00373 |
|
|
| ChEBI_Ref = {{ebicite|changed|EBI}} |
|
|
| ChEBI = 9566 |
|
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
|
| ChEMBL = 479 |
|
|
|
|
|
|
<!--Chemical data--> |
|
<!--Chemical data--> |
|
|
| chemical_formula = C<sub>12</sub>H<sub>15</sub>NO<sub>3</sub>S |
|
| C=21 | H=26 | N=2 | S=2 |
|
|
|
|
|
| molecular_weight = 370.577 |
|
| molecular_weight = 253.32 g/mol |
|
| smiles = S(c2cc1N(c3c(Sc1cc2)cccc3)CCC4N(C)CCCC4)C |
|
|
|
| smiles = C1=CC=C(C=C1)CC(CS)C(=O)NCC(=O)O |
|
| InChI = 1/C21H26N2S2/c1-22-13-6-5-7-16(22)12-14-23-18-8-3-4-9-20(18)25-21-11-10-17(24-2)15-19(21)23/h3-4,8-11,15-16H,5-7,12-14H2,1-2H3 |
|
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
|
| StdInChI = 1S/C21H26N2S2/c1-22-13-6-5-7-16(22)12-14-23-18-8-3-4-9-20(18)25-21-11-10-17(24-2)15-19(21)23/h3-4,8-11,15-16H,5-7,12-14H2,1-2H3 |
|
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
⚫ |
| StdInChIKey = KLBQZWRITKRQQV-UHFFFAOYSA-N |
|
|
}} |
|
}} |