Misplaced Pages

:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox: Difference between revisions - Misplaced Pages

Article snapshot taken from Wikipedia with creative commons attribution-sharealike license. Give it a read and then ask your questions in the chat. We can research this topic together.
< Misplaced Pages:WikiProject Chemicals | Chembox validation Browse history interactively← Previous editNext edit →Content deleted Content addedVisualWikitext
Revision as of 13:20, 10 January 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,055 edits Saving copy of the {{drugbox}} taken from revid 468444172 of page Thioridazine for the Chem/Drugbox validation project (updated: '').← Previous edit Revision as of 13:20, 10 January 2012 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,055 edits Saving copy of the {{drugbox}} taken from revid 451488931 of page Thiorphan for the Chem/Drugbox validation project (updated: 'DrugBank', 'CAS_number').Next edit →
Line 1: Line 1:
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} {{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}}
{{Drugbox
{{drugbox | Verifiedfields = changed
| IUPAC_name = (±)-2-acetic acid
| Watchedfields = changed
| image = Thiorphan.png
| verifiedrevid = 416502199
| width = 200px
| IUPAC_name = 10-{2-ethyl}-<BR>2-methylsulfanylphenothiazine
| imagename = 1 : 1 mixture (racemate)
| image = Thioridazine-2D-skeletal.png
| width = 175 | drug_name = Thiorphan
| image2 = Thioridazine3d.png


<!--Clinical data--> <!--Clinical data-->
| tradename =
| Drugs.com = {{drugs.com|CDI|thioridazine}}
| pregnancy_category =
| MedlinePlus = a682119
| legal_status =
| pregnancy_category = Only if clearly needed
| routes_of_administration =
| legal_status = RX-only-medication, non-narcotic
| routes_of_administration = oral (tablets, concentration, sometimes syrup)


<!--Pharmacokinetic data--> <!--Pharmacokinetic data-->
| bioavailability = incomplete | bioavailability =
| protein_bound =
| metabolism = hepatic | metabolism =
| elimination_half-life = 7–13 hours (up to 20 hours) | elimination_half-life =
| excretion = feces | excretion =


<!--Identifiers--> <!--Identifiers-->
| CAS_number = <!-- blanked - oldvalue: 76721-89-6 -->
| CASNo_Ref = {{cascite|correct|CAS}}
| ATC_prefix =
| CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = 50-52-2 | ATC_suffix =
| StdInChI = 1S/C12H15NO3S/c14-11(15)7-13-12(16)10(8-17)6-9-4-2-1-3-5-9/h1-5,10,17H,6-8H2,(H,13,16)(H,14,15)
| ATC_prefix = N05
| StdInChIKey = LJJKNPQAGWVLDQ-UHFFFAOYSA-N
| ATC_suffix = AC02
| PubChem = 5452 | PubChem = 3132
| DrugBank = <!-- blanked - oldvalue: 3132 -->
| IUPHAR_ligand = 100
| ChemSpiderID = 3020
| DrugBank_Ref = {{drugbankcite|changed|drugbank}}
| DrugBank = DB00679 | ChEMBL = 10247
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 5253
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = N3D6TG58NI
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = D00373
| ChEBI_Ref = {{ebicite|changed|EBI}}
| ChEBI = 9566
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 479


<!--Chemical data--> <!--Chemical data-->
| chemical_formula = C<sub>12</sub>H<sub>15</sub>NO<sub>3</sub>S
| C=21 | H=26 | N=2 | S=2

| molecular_weight = 370.577 | molecular_weight = 253.32 g/mol
| smiles = S(c2cc1N(c3c(Sc1cc2)cccc3)CCC4N(C)CCCC4)C
| smiles = C1=CC=C(C=C1)CC(CS)C(=O)NCC(=O)O
| InChI = 1/C21H26N2S2/c1-22-13-6-5-7-16(22)12-14-23-18-8-3-4-9-20(18)25-21-11-10-17(24-2)15-19(21)23/h3-4,8-11,15-16H,5-7,12-14H2,1-2H3
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C21H26N2S2/c1-22-13-6-5-7-16(22)12-14-23-18-8-3-4-9-20(18)25-21-11-10-17(24-2)15-19(21)23/h3-4,8-11,15-16H,5-7,12-14H2,1-2H3
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = KLBQZWRITKRQQV-UHFFFAOYSA-N
}} }}

Revision as of 13:20, 10 January 2012

This page contains a copy of the infobox ({{drugbox}}) taken from revid 451488931 of page Thiorphan with values updated to verified values.
Thiorphan
Identifiers
IUPAC name
  • (±)-2-acetic acid
PubChem CID
ChemSpider
ChEMBL
Chemical and physical data
FormulaC12H15NO3S
Molar mass253.32 g/mol
3D model (JSmol)
SMILES
  • C1=CC=C(C=C1)CC(CS)C(=O)NCC(=O)O
InChI
  • InChI=1S/C12H15NO3S/c14-11(15)7-13-12(16)10(8-17)6-9-4-2-1-3-5-9/h1-5,10,17H,6-8H2,(H,13,16)(H,14,15)
  • Key:LJJKNPQAGWVLDQ-UHFFFAOYSA-N
Misplaced Pages:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox: Difference between revisions Add topic