Misplaced Pages:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox: Difference between revisions

< Misplaced Pages:WikiProject Chemicals | Chembox validation Browse history interactively ← Previous editContent deleted Content addedVisual WikitextInline

Revision as of 19:59, 16 February 2012 editBeetstra (talk \| contribs)Edit filter managers, Administrators172,055 edits Saving copy of the {{drugbox}} taken from revid 473541861 of page Aciclovir for the Chem/Drugbox validation project (updated: 'DrugBank').← Previous edit		Latest revision as of 14:25, 29 January 2022 edit undo119.246.116.98 (talk)No edit summary
(711 intermediate revisions by 8 users not shown)
Line 1:		Line 1:
	{{ambox \| text = This page contains a copy of the infobox ({{tl\|drugbox}}) taken from revid of page ] with values updated to verified values.}}		{{ambox \| text = This page contains a copy of the infobox ({{tl\|drugbox}}) taken from revid of page ] with values updated to verified values.}}
	{{~~Drugbox~~		{{drugbox
		⚫	\| verifiedrevid = 477001424
	\| Verifiedfields = changed
			\| IUPAC_name = 2-Oxo-<small>L</small>-threo-hexono-1,4-lactone-2,3-enediol<br />''or''<br />(''R'')-3,4-dihydroxy-5-((''S'')- 1,2-dihydroxyethyl)furan-2(5''H'')-one
	\| Watchedfields = changed
		⚫	\| image = L-Ascorbic_acid.svg
⚫	\| verifiedrevid = ~~457802576~~
			\| width = 200px
	\| IUPAC_name = 2-Amino-1,9-dihydro-9-((2-hydroxyethoxy)methyl)-6''H''-Purin-6-one
			\| image2 = Ascorbic-acid-from-xtal-1997-3D-balls.png
⚫	\| image = ~~Aciclovir standard~~.svg
			\| width2 = 200px
	\| image2 = Acyclovir 3D.png

	<!--Clinical data-->		<!--Clinical data-->
		⚫	\| Drugs.com = {{drugs.com\|MTM\|vitamin_c}}
	\| tradename =
			\| licence_EU = <!-- EMEA requires brand name -->
⚫	\| Drugs.com = {{drugs.com\|~~monograph~~\|~~acyclovir~~}}
			\| licence_US = <!-- FDA may use generic name -->
	\| MedlinePlus = a681045
			\| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
	\| pregnancy_category = B3 <small>(])</small>, B <small>(U.S.)</small>
			\| pregnancy_US = <!-- A / B / C / D / X -->
	\| legal_US = Rx-only
			\| pregnancy_category = A
	\| legal_status = unscheduled/S4 <small>(Au)</small>, POM <small>(UK)</small>
			\| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 -->
⚫	\| routes_of_administration = ], oral~~, topical~~
			\| legal_CA = <!-- / Schedule I, II, III, IV, V, VI, VII, VIII -->
			\| legal_UK = <!-- GSL / P / POM / CD / Class A, B, C -->
			\| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V -->
			\| legal_status = general public availability
		⚫	\| routes_of_administration = oral

	<!--Pharmacokinetic data-->		<!--Pharmacokinetic data-->
	\| bioavailability = ~~10–20%~~ ~~(oral)~~		\| bioavailability = rapid & complete
	\| protein_bound = ~~9–33%~~		\| protein_bound = negligible
			\| elimination_half-life = varies according to plasma concentration <!-- can be 30 min to weeks, depending on body stores -->
	\| metabolism = Viral thymidine kinase
		⚫	\| excretion = renal
	\| elimination_half-life = 2.2–20 hours
⚫	\| excretion = ]

	<!--Identifiers-->		<!--Identifiers-->
	\| CASNo_Ref = {{cascite\|correct\|CAS}}		\| CASNo_Ref = {{cascite\|correct\|CAS}}
	\| CAS_number_Ref = {{cascite\|correct\|??}}		\| CAS_number_Ref = {{cascite\|correct\|??}}
	\| CAS_number = ~~59277~~-89-3		\| CAS_number = 50-81-7
	\| ATC_prefix = ~~J05~~		\| ATC_prefix = A
	\| ATC_suffix = ~~AB01~~		\| ATC_suffix = 11G
		⚫	\| ChEBI_Ref = {{ebicite\|correct\|EBI}}
	\| ATC_supplemental = {{ATC\|D06\|BB03}} {{ATC\|S01\|AD03}}
	\| ~~PubChem~~ = ~~2022~~		\| ChEBI = 29073
			\| PubChem = 5785
	\| DrugBank_Ref = {{drugbankcite\|~~changed~~\|drugbank}}		\| DrugBank_Ref = {{drugbankcite\|correct\|drugbank}}
	\| DrugBank = ~~DB00787~~		\| DrugBank = DB00126
	\| ChemSpiderID_Ref = {{chemspidercite\|correct\|chemspider}}		\| ChemSpiderID_Ref = {{chemspidercite\|correct\|chemspider}}
	\| ChemSpiderID = ~~1945~~		\| ChemSpiderID = 10189562
			\| NIAID_ChemDB = 002072
	\| UNII_Ref = {{fdacite\|correct\|FDA}}		\| UNII_Ref = {{fdacite\|correct\|FDA}}
	\| UNII = ~~X4HES1O11F~~		\| UNII = PQ6CK8PD0R
	\| KEGG_Ref = {{keggcite\|correct\|kegg}}		\| KEGG_Ref = {{keggcite\|correct\|kegg}}
	\| KEGG = ~~D00222~~		\| KEGG = D00018
⚫	\| ChEBI_Ref = {{ebicite\|correct\|EBI}}
	\| ChEBI = 2453
	\| ChEMBL_Ref = {{ebicite\|correct\|EBI}}		\| ChEMBL_Ref = {{ebicite\|correct\|EBI}}
	\| ChEMBL = ~~184~~		\| ChEMBL = 196

	<!--Chemical data-->		<!--Chemical data-->
			\| chemical_formula =
	\| C=8 \| H=~~11 \| N=5~~ \| O=3		\| C=6 \| H=7 \| O=6
	\| molecular_weight = ~~225~~.21 g/~~mol~~		\| molecular_weight = 176.12 g/]
	\| smiles = O=C2/N=C(\Nc1n(cnc12)COCCO)N
			\| smiles = C((1C(=C(C(=O)O1)O)O)O)O
	\| InChI = 1/C8H11N5O3/c9-8-11-6-5(7(15)12-8)10-3-13(6)4-16-2-1-14/h3,14H,1-2,4H2,(H3,9,11,12,15)
			\| InChI = 1/C6H8O6/c7-1-2(8)5-3(9)4(10)6(11)12-5/h2,5,7-10H,1H2/t2-,5+/m0/s1
	\| InChIKey = MKUXAQIIEYXACX-UHFFFAOYAG
	\| StdInChI_Ref = {{stdinchicite\|correct\|chemspider}}		\| StdInChI_Ref = {{stdinchicite\|correct\|chemspider}}
	\| StdInChI = 1S/~~C8H11N5O3~~/c9-8-~~11-6-5~~(~~7(15)12-~~8)10-3~~-13~~(6)4-~~16-2-1-14~~/h3,~~14H~~,1-2,~~4H2~~,~~(H3,9,11,12,15)~~		\| StdInChI = 1S/C6H8O6/c7-1-2(8)5-3(9)4(10)6(11)12-5/h2,5,7-10H,1H2/t2-,5+/m0/s1
	\| StdInChIKey_Ref = {{stdinchicite\|correct\|chemspider}}		\| StdInChIKey_Ref = {{stdinchicite\|correct\|chemspider}}
	\| StdInChIKey = ~~MKUXAQIIEYXACX~~-~~UHFFFAOYSA~~-N		\| StdInChIKey = CIWBSHSKHKDKBQ-JLAZNSOCSA-N
	\| synonyms = ~~acycloguanosine~~		\| synonyms = <small>L</small>-ascorbic acid
	\| ~~melting_point~~ = ~~256~~.5		\| density = 1.694
			\| melting_point = 190
			\| boiling_point = 553
	}}		}}

Latest revision as of 14:25, 29 January 2022

This page contains a copy of the infobox ({{drugbox}}) taken from revid 477243833 of page Vitamin_C with values updated to verified values.

WikiProject Chemicals/Chembox validation/VerifiedDataSandbox
Clinical data


Other names	L-ascorbic acid
AHFS/Drugs.com	Multum Consumer Information
Pregnancy category	A
Routes of administration	oral
ATC code	A11G (WHO)
Legal status
Legal status	general public availability
Pharmacokinetic data
Bioavailability	rapid & complete
Protein binding	negligible
Elimination half-life	varies according to plasma concentration
Excretion	renal
Identifiers
IUPAC name 2-Oxo-L-threo-hexono-1,4-lactone-2,3-enediol or (R)-3,4-dihydroxy-5-((S)- 1,2-dihydroxyethyl)furan-2(5H)-one
CAS Number	50-81-7
PubChem CID	5785
DrugBank	DB00126
ChemSpider	10189562
UNII	PQ6CK8PD0R
KEGG	D00018
ChEBI	CHEBI:29073
ChEMBL	ChEMBL196
NIAID ChemDB	002072
Chemical and physical data
Formula	C₆H₇O₆
Molar mass	176.12 g/mole g·mol
3D model (JSmol)	Interactive image
Density	1.694 g/cm
Melting point	190 °C (374 °F)
Boiling point	553 °C (1,027 °F)
SMILES C((1C(=C(C(=O)O1)O)O)O)O
InChI InChI=1S/C6H8O6/c7-1-2(8)5-3(9)4(10)6(11)12-5/h2,5,7-10H,1H2/t2-,5+/m0/s1 Key:CIWBSHSKHKDKBQ-JLAZNSOCSA-N
(verify)